Difference between revisions of "PWY3O-355"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13205 CPD-13205] == * smiles: ** C(C(C(C(C(CO)O)OC1(C(C(C(C(CO)O1)OC2(C(C(C(C(CO)O2)OC3(C(C...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY3O-355 PWY3O-355] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13205 CPD-13205] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY3O-355 PWY3O-355] ==
−
* smiles:
+
* taxonomic range:
−
** C(C(C(C(C(CO)O)OC1(C(C(C(C(CO)O1)OC2(C(C(C(C(CO)O2)OC3(C(C(C(C(CO)O3)O)O)O))O)O))O)O))O)O)=O
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
−
* inchi key:
+
−
** InChIKey=UYQJCPNSAVWAFU-ZEUIETHYSA-N
+
 
* common name:
 
* common name:
−
** cellotetraose
+
** stearate biosynthesis III (fungi)
−
* molecular weight:
+
−
** 666.583   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** fatty acid biosynthesis
 +
** stearic acid biosynthesis
 +
** octadecanoate biosynthesis
 +
** saturated fatty acid biosynthesis
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[RXN-12305]]
+
'''6''' reactions found over '''6''' reactions in the full pathway
−
== Reaction(s) known to produce the compound ==
+
* [[RXN-9624]]
−
== Reaction(s) of unknown directionality ==
+
** 2 associated gene(s):
 +
*** [[Tiso_gene_7477]]
 +
*** [[Tiso_gene_801]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-creinhardtii]]
 +
* [[RXN-9633]]
 +
** 7 associated gene(s):
 +
*** [[Tiso_gene_10876]]
 +
*** [[Tiso_gene_9885]]
 +
*** [[Tiso_gene_136]]
 +
*** [[Tiso_gene_135]]
 +
*** [[Tiso_gene_500]]
 +
*** [[Tiso_gene_13394]]
 +
*** [[Tiso_gene_13083]]
 +
** 4 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[manual-primary_network]]
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN-9634]]
 +
** 6 associated gene(s):
 +
*** [[Tiso_gene_10876]]
 +
*** [[Tiso_gene_500]]
 +
*** [[Tiso_gene_136]]
 +
*** [[Tiso_gene_135]]
 +
*** [[Tiso_gene_13394]]
 +
*** [[Tiso_gene_6884]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[manual-primary_network]]
 +
*** [[annotation-in-silico_annotation]]
 +
* [[RXN3O-1803]]
 +
** 9 associated gene(s):
 +
*** [[Tiso_gene_135]]
 +
*** [[Tiso_gene_5939]]
 +
*** [[Tiso_gene_13394]]
 +
*** [[Tiso_gene_14485]]
 +
*** [[Tiso_gene_19302]]
 +
*** [[Tiso_gene_500]]
 +
*** [[Tiso_gene_10876]]
 +
*** [[Tiso_gene_136]]
 +
*** [[Tiso_gene_15991]]
 +
** 6 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-synechocystis]]
 +
*** [[manual-primary_network]]
 +
* [[RXN3O-5293]]
 +
** 5 associated gene(s):
 +
*** [[Tiso_gene_10876]]
 +
*** [[Tiso_gene_136]]
 +
*** [[Tiso_gene_135]]
 +
*** [[Tiso_gene_13394]]
 +
*** [[Tiso_gene_500]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
* [[RXN3O-5304]]
 +
** 5 associated gene(s):
 +
*** [[Tiso_gene_500]]
 +
*** [[Tiso_gene_135]]
 +
*** [[Tiso_gene_13394]]
 +
*** [[Tiso_gene_136]]
 +
*** [[Tiso_gene_10876]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-4751}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=170125 170125]
+
{{#set: common name=stearate biosynthesis III (fungi)}}
−
* CHEMSPIDER:
+
{{#set: common name=fatty acid biosynthesis|stearic acid biosynthesis|octadecanoate biosynthesis|saturated fatty acid biosynthesis}}
−
** [http://www.chemspider.com/Chemical-Structure.148760.html 148760]
+
{{#set: reaction found=6}}
−
{{#set: smiles=C(C(C(C(C(CO)O)OC1(C(C(C(C(CO)O1)OC2(C(C(C(C(CO)O2)OC3(C(C(C(C(CO)O3)O)O)O))O)O))O)O))O)O)=O}}
+
{{#set: total reaction=6}}
−
{{#set: inchi key=InChIKey=UYQJCPNSAVWAFU-ZEUIETHYSA-N}}
+
{{#set: completion rate=100.0}}
−
{{#set: common name=cellotetraose}}
+
−
{{#set: molecular weight=666.583    }}
+
−
{{#set: consumed by=RXN-12305}}
+

Latest revision as of 19:12, 21 March 2018

Pathway PWY3O-355

  • taxonomic range:
  • common name:
    • stearate biosynthesis III (fungi)
  • Synonym(s):
    • fatty acid biosynthesis
    • stearic acid biosynthesis
    • octadecanoate biosynthesis
    • saturated fatty acid biosynthesis

Reaction(s) found

6 reactions found over 6 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=PWY3O-355&oldid=40127"