Difference between revisions of "CPD-13205"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5451 PWY-5451] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-40674 TAX-4...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13205 CPD-13205] == * smiles: ** C(C(C(C(C(CO)O)OC1(C(C(C(C(CO)O1)OC2(C(C(C(C(CO)O2)OC3(C(C...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Pathway]]
+
[[Category:Metabolite]]
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5451 PWY-5451] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13205 CPD-13205] ==
* taxonomic range:
+
* smiles:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-40674 TAX-40674]
+
** C(C(C(C(C(CO)O)OC1(C(C(C(C(CO)O1)OC2(C(C(C(C(CO)O2)OC3(C(C(C(C(CO)O3)O)O)O))O)O))O)O))O)O)=O
 
* common name:
 
* common name:
** acetone degradation I (to methylglyoxal)
+
** cellotetraose
 +
* inchi key:
 +
** InChIKey=UYQJCPNSAVWAFU-ZEUIETHYSA-N
 +
* molecular weight:
 +
** 666.583   
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
* '''2''' reaction(s) found
+
* [[RXN-12305]]
** [[ACETOACETATE-DECARBOXYLASE-RXN]]
+
== Reaction(s) known to produce the compound ==
** [[RXN-8630]]
+
== Reaction(s) of unknown directionality ==
== Reaction(s) not found ==
+
* '''2''' reaction(s) not found
+
** [http://metacyc.org/META/NEW-IMAGE?object=ISOPROPANOL-DEHYDROGENASE-NADP+-RXN ISOPROPANOL-DEHYDROGENASE-NADP+-RXN]
+
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-17627 RXN-17627]
+
 
== External links  ==
 
== External links  ==
{{#set: taxonomic range=TAX-40674}}
+
* PUBCHEM:
{{#set: common name=acetone degradation I (to methylglyoxal)}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=170125 170125]
{{#set: reaction found=2}}
+
* CHEMSPIDER:
{{#set: reaction not found=2}}
+
** [http://www.chemspider.com/Chemical-Structure.148760.html 148760]
 +
{{#set: smiles=C(C(C(C(C(CO)O)OC1(C(C(C(C(CO)O1)OC2(C(C(C(C(CO)O2)OC3(C(C(C(C(CO)O3)O)O)O))O)O))O)O))O)O)=O}}
 +
{{#set: common name=cellotetraose}}
 +
{{#set: inchi key=InChIKey=UYQJCPNSAVWAFU-ZEUIETHYSA-N}}
 +
{{#set: molecular weight=666.583    }}
 +
{{#set: consumed by=RXN-12305}}

Latest revision as of 19:12, 21 March 2018

Metabolite CPD-13205

  • smiles:
    • C(C(C(C(C(CO)O)OC1(C(C(C(C(CO)O1)OC2(C(C(C(C(CO)O2)OC3(C(C(C(C(CO)O3)O)O)O))O)O))O)O))O)O)=O
  • common name:
    • cellotetraose
  • inchi key:
    • InChIKey=UYQJCPNSAVWAFU-ZEUIETHYSA-N
  • molecular weight:
    • 666.583
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links