Difference between revisions of "PWY-6146"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13205 CPD-13205] == * smiles: ** C(C(C(C(C(CO)O)OC1(C(C(C(C(CO)O1)OC2(C(C(C(C(CO)O2)OC3(C(C...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6146 PWY-6146] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-21...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13205 CPD-13205] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6146 PWY-6146] ==
* smiles:
+
* taxonomic range:
** C(C(C(C(C(CO)O)OC1(C(C(C(C(CO)O1)OC2(C(C(C(C(CO)O2)OC3(C(C(C(C(CO)O3)O)O)O))O)O))O)O))O)O)=O
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
 
* common name:
 
* common name:
** cellotetraose
+
** Methanobacterium thermoautotrophicum biosynthetic metabolism
* inchi key:
+
** InChIKey=UYQJCPNSAVWAFU-ZEUIETHYSA-N
+
* molecular weight:
+
** 666.583   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-12305]]
+
'''7''' reactions found over '''16''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[ALANINE-SYN2-PWY]]
== Reaction(s) of unknown directionality ==
+
** 0 associated gene:
 +
* [[ASPARTATESYN-PWY]]
 +
** 0 associated gene:
 +
* [[CODH-PWY]]
 +
** 0 associated gene:
 +
* [[P42-PWY]]
 +
** 0 associated gene:
 +
* [[PWY-5910]]
 +
** 0 associated gene:
 +
* [[PWY-6142]]
 +
** 0 associated gene:
 +
* [[PYRUVATE-CARBOXYLASE-RXN]]
 +
** 3 associated gene(s):
 +
*** [[Tiso_gene_15144]]
 +
*** [[Tiso_gene_15145]]
 +
*** [[Tiso_gene_2812]]
 +
** 4 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[manual-primary_network]]
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=PEPCARBOX-RXN PEPCARBOX-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=PWY-6141 PWY-6141]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=PWY-6141 PWY-6141]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: taxonomic range=TAX-2157}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=170125 170125]
+
{{#set: common name=Methanobacterium thermoautotrophicum biosynthetic metabolism}}
* CHEMSPIDER:
+
{{#set: reaction found=7}}
** [http://www.chemspider.com/Chemical-Structure.148760.html 148760]
+
{{#set: total reaction=16}}
{{#set: smiles=C(C(C(C(C(CO)O)OC1(C(C(C(C(CO)O1)OC2(C(C(C(C(CO)O2)OC3(C(C(C(C(CO)O3)O)O)O))O)O))O)O))O)O)=O}}
+
{{#set: completion rate=44.0}}
{{#set: common name=cellotetraose}}
+
{{#set: inchi key=InChIKey=UYQJCPNSAVWAFU-ZEUIETHYSA-N}}
+
{{#set: molecular weight=666.583    }}
+
{{#set: consumed by=RXN-12305}}
+

Latest revision as of 19:12, 21 March 2018

Pathway PWY-6146

  • taxonomic range:
  • common name:
    • Methanobacterium thermoautotrophicum biosynthetic metabolism
  • Synonym(s):

Reaction(s) found

7 reactions found over 16 reactions in the full pathway

Reaction(s) not found

External links