Difference between revisions of "8-AMINO-7-OXONONANOATE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-3841 PWY-3841] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-3...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=8-AMINO-7-OXONONANOATE 8-AMINO-7-OXONONANOATE] == * smiles: ** CC(C(CCCCCC([O-])=O)=O)[N+] * co...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Pathway]]
+
[[Category:Metabolite]]
−
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-3841 PWY-3841] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=8-AMINO-7-OXONONANOATE 8-AMINO-7-OXONONANOATE] ==
−
* taxonomic range:
+
* smiles:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
+
** CC(C(CCCCCC([O-])=O)=O)[N+]
 
* common name:
 
* common name:
−
** folate transformations II
+
** 8-amino-7-oxononanoate
 +
* inchi key:
 +
** InChIKey=GUAHPAJOXVYFON-UHFFFAOYSA-N
 +
* molecular weight:
 +
** 187.238   
 
* Synonym(s):
 
* Synonym(s):
 +
** 7-keto-8-aminopelargonate
 +
** KAPA
 +
** 7-KAP
  
−
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
−
'''9''' reactions found over '''11''' reactions in the full pathway
+
== Reaction(s) known to produce the compound ==
−
* [[1.5.1.20-RXN]]
+
* [[7KAPSYN-RXN]]
−
** 2 associated gene(s):
+
* [[RXN-11484]]
−
*** [[Tiso_gene_14582]]
+
== Reaction(s) of unknown directionality ==
−
*** [[Tiso_gene_16954]]
+
* [[DAPASYN-RXN]]
−
** 4 reconstruction source(s) associated:
+
−
*** [[annotation-experimental_annotation]]
+
−
*** [[manual-primary_network]]
+
−
*** [[annotation-in-silico_annotation]]
+
−
*** [[orthology-esiliculosus]]
+
−
* [[DIHYDROFOLATEREDUCT-RXN]]
+
−
** 0 associated gene:
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[manual-primary_network]]
+
−
* [[FORMATETHFLIG-RXN]]
+
−
** 2 associated gene(s):
+
−
*** [[Tiso_gene_432]]
+
−
*** [[Tiso_gene_7582]]
+
−
** 4 reconstruction source(s) associated:
+
−
*** [[annotation-in-silico_annotation]]
+
−
*** [[manual-primary_network]]
+
−
*** [[annotation-experimental_annotation]]
+
−
*** [[orthology-esiliculosus]]
+
−
* [[GLYOHMETRANS-RXN]]
+
−
** 4 associated gene(s):
+
−
*** [[Tiso_gene_16153]]
+
−
*** [[Tiso_gene_16154]]
+
−
*** [[Tiso_gene_18652]]
+
−
*** [[Tiso_gene_7776]]
+
−
** 4 reconstruction source(s) associated:
+
−
*** [[annotation-in-silico_annotation]]
+
−
*** [[manual-primary_network]]
+
−
*** [[annotation-experimental_annotation]]
+
−
*** [[orthology-esiliculosus]]
+
−
* [[HOMOCYSMETB12-RXN]]
+
−
** 1 associated gene(s):
+
−
*** [[Tiso_gene_1602]]
+
−
** 4 reconstruction source(s) associated:
+
−
*** [[annotation-in-silico_annotation]]
+
−
*** [[manual-primary_network]]
+
−
*** [[annotation-experimental_annotation]]
+
−
*** [[orthology-esiliculosus]]
+
−
* [[METHENYLTHFCYCLOHYDRO-RXN]]
+
−
** 0 associated gene:
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[manual-primary_network]]
+
−
* [[METHYLENETHFDEHYDROG-NADP-RXN]]
+
−
** 2 associated gene(s):
+
−
*** [[Tiso_gene_432]]
+
−
*** [[Tiso_gene_6004]]
+
−
** 3 reconstruction source(s) associated:
+
−
*** [[manual-primary_network]]
+
−
*** [[annotation-in-silico_annotation]]
+
−
*** [[orthology-esiliculosus]]
+
−
* [[RXN-6321]]
+
−
** 1 associated gene(s):
+
−
*** [[Tiso_gene_17287]]
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[orthology-esiliculosus]]
+
−
* [[THYMIDYLATESYN-RXN]]
+
−
** 2 associated gene(s):
+
−
*** [[Tiso_gene_18478]]
+
−
*** [[Tiso_gene_7708]]
+
−
** 2 reconstruction source(s) associated:
+
−
*** [[manual-primary_network]]
+
−
*** [[annotation-in-silico_annotation]]
+
−
== Reaction(s) not found ==
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=5-FORMYL-THF-CYCLO-LIGASE-RXN 5-FORMYL-THF-CYCLO-LIGASE-RXN]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=GCVMULTI-RXN GCVMULTI-RXN]
+
 
== External links  ==
 
== External links  ==
−
* ARACYC:
+
* LIGAND-CPD:
−
** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-3841 PWY-3841]
+
** [http://www.genome.jp/dbget-bin/www_bget?C01092 C01092]
−
{{#set: taxonomic range=TAX-33090}}
+
* HMDB : HMDB37790
−
{{#set: common name=folate transformations II}}
+
* CHEBI:
−
{{#set: reaction found=9}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57532 57532]
−
{{#set: total reaction=11}}
+
* BIGG : 8aonn
−
{{#set: completion rate=82.0}}
+
* PUBCHEM:
 +
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244029 25244029]
 +
{{#set: smiles=CC(C(CCCCCC([O-])=O)=O)[N+]}}
 +
{{#set: common name=8-amino-7-oxononanoate}}
 +
{{#set: inchi key=InChIKey=GUAHPAJOXVYFON-UHFFFAOYSA-N}}
 +
{{#set: molecular weight=187.238    }}
 +
{{#set: common name=7-keto-8-aminopelargonate|KAPA|7-KAP}}
 +
{{#set: produced by=7KAPSYN-RXN|RXN-11484}}
 +
{{#set: reversible reaction associated=DAPASYN-RXN}}

Latest revision as of 19:12, 21 March 2018

Metabolite 8-AMINO-7-OXONONANOATE

  • smiles:
    • CC(C(CCCCCC([O-])=O)=O)[N+]
  • common name:
    • 8-amino-7-oxononanoate
  • inchi key:
    • InChIKey=GUAHPAJOXVYFON-UHFFFAOYSA-N
  • molecular weight:
    • 187.238
  • Synonym(s):
    • 7-keto-8-aminopelargonate
    • KAPA
    • 7-KAP

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C(CCCCCC([O-])=O)=O)[N+" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=8-AMINO-7-OXONONANOATE&oldid=40182"