Difference between revisions of "CPD0-971"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=8-AMINO-7-OXONONANOATE 8-AMINO-7-OXONONANOATE] == * smiles: ** CC(C(CCCCCC([O-])=O)=O)[N+] * co...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-971 CPD0-971] == * common name: ** an α-limit dextrin * Synonym(s): ** a glycogen ph...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-971 CPD0-971] == |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** an α-limit dextrin |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** a glycogen phosphorylase-limit dextrin |
| − | + | ** a glycogen phosphorylase-limited dextrin | |
| − | ** | + | |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | * [[ | + | * [[GLYCOPHOSPHORYL-RXN]] |
== External links == | == External links == | ||
| − | + | {{#set: common name=an α-limit dextrin}} | |
| − | + | {{#set: common name=a glycogen phosphorylase-limit dextrin|a glycogen phosphorylase-limited dextrin}} | |
| − | + | {{#set: reversible reaction associated=GLYCOPHOSPHORYL-RXN}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: common name= | + | |
| − | + | ||
| − | + | ||
| − | {{#set: common name= | + | |
| − | + | ||
| − | {{#set: reversible reaction associated= | + | |
Latest revision as of 20:12, 21 March 2018
Contents
Metabolite CPD0-971
- common name:
- an α-limit dextrin
- Synonym(s):
- a glycogen phosphorylase-limit dextrin
- a glycogen phosphorylase-limited dextrin
