Difference between revisions of "4OH2OXOGLUTARALDOL-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-377 CPD-377] == * smiles: ** C(C(C(C(C(CO)O)O)O)=O)([O-])=O * inchi key: ** InChIKey=VBUYCZ...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=4OH2OXOGLUTARALDOL-RXN 4OH2OXOGLUTARALDOL-RXN] == * direction: ** REVERSIBLE * ec number: ** [http:...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=4OH2OXOGLUTARALDOL-RXN 4OH2OXOGLUTARALDOL-RXN] == |
− | * | + | * direction: |
− | ** | + | ** REVERSIBLE |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/4.1.3.16 EC-4.1.3.16] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | = | + | * With identifiers: |
− | == | + | ** 1 [[CPD-15015]][c] '''<=>''' 1 [[GLYOX]][c] '''+''' 1 [[PYRUVATE]][c] |
− | * [[ | + | * With common name(s): |
+ | ** 1 4-hydroxy-2-oxoglutarate[c] '''<=>''' 1 glyoxylate[c] '''+''' 1 pyruvate[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_12620]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways == | ||
+ | * [[HYDROXYPRODEG-PWY]], trans-4-hydroxy-L-proline degradation I: [http://metacyc.org/META/NEW-IMAGE?object=HYDROXYPRODEG-PWY HYDROXYPRODEG-PWY] | ||
+ | ** '''1''' reactions found over '''5''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
− | * LIGAND- | + | * LIGAND-RXN: |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?R00470 R00470] |
− | * | + | * UNIPROT: |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P44480 P44480] |
− | * | + | ** [http://www.uniprot.org/uniprot/P0A955 P0A955] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/Q9JR44 Q9JR44] |
− | * | + | ** [http://www.uniprot.org/uniprot/O25729 O25729] |
− | * | + | ** [http://www.uniprot.org/uniprot/Q9ZKB4 Q9ZKB4] |
− | * | + | ** [http://www.uniprot.org/uniprot/O83578 O83578] |
− | ** [http:// | + | ** [http://www.uniprot.org/uniprot/Q9WXS1 Q9WXS1] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P50846 P50846] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P38448 P38448] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q55872 Q55872] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P94802 P94802] |
− | {{#set: | + | {{#set: direction=REVERSIBLE}} |
− | {{#set: | + | {{#set: ec number=EC-4.1.3.16}} |
+ | {{#set: gene associated=Tiso_gene_12620}} | ||
+ | {{#set: in pathway=HYDROXYPRODEG-PWY}} | ||
+ | {{#set: reconstruction category=orthology}} | ||
+ | {{#set: reconstruction source=orthology-esiliculosus}} | ||
+ | {{#set: reconstruction tool=pantograph}} |
Latest revision as of 19:13, 21 March 2018
Contents
Reaction 4OH2OXOGLUTARALDOL-RXN
- direction:
- REVERSIBLE
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 4-hydroxy-2-oxoglutarate[c] <=> 1 glyoxylate[c] + 1 pyruvate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_12620
- Source: orthology-esiliculosus
Pathways
- HYDROXYPRODEG-PWY, trans-4-hydroxy-L-proline degradation I: HYDROXYPRODEG-PWY
- 1 reactions found over 5 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-esiliculosus
External links
- LIGAND-RXN:
- UNIPROT: