Difference between revisions of "Tiso gene 15067"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12366 CPD-12366] == * smiles: ** C(OP(=O)([O-])OP(=O)(OP([O-])([O-])=O)[O-])C1(OC(C(O)C(O)1...")
(Created page with "Category:Gene == Gene Tiso_gene_15067 == * right end position: ** 5231 * transcription direction: ** NEGATIVE * left end position: ** 496 * centisome position: ** 9.435039...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12366 CPD-12366] ==
+
== Gene Tiso_gene_15067 ==
* smiles:
+
* right end position:
** C(OP(=O)([O-])OP(=O)(OP([O-])([O-])=O)[O-])C1(OC(C(O)C(O)1)N3(C(=O)NC2(C(=O)NC(N)=NC=23)))
+
** 5231
* inchi key:
+
* transcription direction:
** InChIKey=JCHLKIQZUXYLPW-UMMCILCDSA-J
+
** NEGATIVE
* common name:
+
* left end position:
** 8-oxo-GTP
+
** 496
* molecular weight:
+
* centisome position:
** 535.151    
+
** 9.435039    
 
* Synonym(s):
 
* Synonym(s):
** 8-oxo-guanosine-triphosphate
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* Reaction: [[3.2.1.21-RXN]]
* [[RXN-11409]]
+
** Source: [[annotation-in-silico_annotation]]
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
* Reaction: [[RXN-10769]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-10773]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-13602]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-13603]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-14179]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-5341]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-8036]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-9674]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY-3121]]
 +
* [[PWY-6002]]
 +
* [[PWY-6788]]
 +
* [[PWY-5176]]
 +
* [[PWY-7092]]
 +
* [[PWY-7091]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: right end position=5231}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173271 46173271]
+
{{#set: transcription direction=NEGATIVE}}
{{#set: smiles=C(OP(=O)([O-])OP(=O)(OP([O-])([O-])=O)[O-])C1(OC(C(O)C(O)1)N3(C(=O)NC2(C(=O)NC(N)=NC=23)))}}
+
{{#set: left end position=496}}
{{#set: inchi key=InChIKey=JCHLKIQZUXYLPW-UMMCILCDSA-J}}
+
{{#set: centisome position=9.435039   }}
{{#set: common name=8-oxo-GTP}}
+
{{#set: reaction associated=3.2.1.21-RXN|RXN-10769|RXN-10773|RXN-13602|RXN-13603|RXN-14179|RXN-5341|RXN-8036|RXN-9674}}
{{#set: molecular weight=535.151   }}
+
{{#set: pathway associated=PWY-3121|PWY-6002|PWY-6788|PWY-5176|PWY-7092|PWY-7091}}
{{#set: common name=8-oxo-guanosine-triphosphate}}
+
{{#set: produced by=RXN-11409}}
+

Latest revision as of 20:13, 21 March 2018

Gene Tiso_gene_15067

  • right end position:
    • 5231
  • transcription direction:
    • NEGATIVE
  • left end position:
    • 496
  • centisome position:
    • 9.435039
  • Synonym(s):

Reactions associated

Pathways associated

External links