Difference between revisions of "PWY-7341"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-377 CPD-377] == * smiles: ** C(C(C(C(C(CO)O)O)O)=O)([O-])=O * inchi key: ** InChIKey=VBUYCZ...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7341 PWY-7341] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4070 TAX-40...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-377 CPD-377] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7341 PWY-7341] ==
−
* smiles:
+
* taxonomic range:
−
** C(C(C(C(C(CO)O)O)O)=O)([O-])=O
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4070 TAX-4070]
−
* inchi key:
+
−
** InChIKey=VBUYCZFBVCCYFD-JJYYJPOSSA-M
+
 
* common name:
 
* common name:
−
** 2-keto-D-gluconate
+
** superpathway of hyoscyamine and scopolamine biosynthesis
−
* molecular weight:
+
−
** 193.133   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 2-dehydro-D-gluconate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
'''2''' reactions found over '''12''' reactions in the full pathway
−
== Reaction(s) of unknown directionality ==
+
* [[PWY-5317]]
−
* [[1.1.1.274-RXN]]
+
** 0 associated gene:
 +
* [[TROPINE-DEHYDROGENASE-RXN]]
 +
** 2 associated gene(s):
 +
*** [[Tiso_gene_15179]]
 +
*** [[Tiso_gene_15180]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-esiliculosus]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=6-BETA-HYDROXYHYOSCYAMINE-EPOXIDASE-RXN 6-BETA-HYDROXYHYOSCYAMINE-EPOXIDASE-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=HYOSCYAMINE-6-DIOXYGENASE-RXN HYOSCYAMINE-6-DIOXYGENASE-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=PWY-5315 PWY-5315]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=PWY-5315 PWY-5315]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8251 RXN-8251]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8252 RXN-8252]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8253 RXN-8253]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8254 RXN-8254]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8255 RXN-8255]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: taxonomic range=TAX-4070}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C06473 C06473]
+
{{#set: common name=superpathway of hyoscyamine and scopolamine biosynthesis}}
−
* CHEMSPIDER:
+
{{#set: reaction found=2}}
−
** [http://www.chemspider.com/Chemical-Structure.5256721.html 5256721]
+
{{#set: total reaction=12}}
−
* CHEBI:
+
{{#set: completion rate=17.0}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16808 16808]
+
−
* BIGG : 2dhglcn
+
−
* BIGG : 2dhguln
+
−
* PUBCHEM:
+
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6857381 6857381]
+
−
{{#set: smiles=C(C(C(C(C(CO)O)O)O)=O)([O-])=O}}
+
−
{{#set: inchi key=InChIKey=VBUYCZFBVCCYFD-JJYYJPOSSA-M}}
+
−
{{#set: common name=2-keto-D-gluconate}}
+
−
{{#set: molecular weight=193.133    }}
+
−
{{#set: common name=2-dehydro-D-gluconate}}
+
−
{{#set: consumed or produced by=1.1.1.274-RXN}}
+

Latest revision as of 19:13, 21 March 2018

Pathway PWY-7341

  • taxonomic range:
  • common name:
    • superpathway of hyoscyamine and scopolamine biosynthesis
  • Synonym(s):

Reaction(s) found

2 reactions found over 12 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=PWY-7341&oldid=40231"