Difference between revisions of "CPD-12366"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-5131 RXN0-5131] == * direction: ** REVERSIBLE * common name: ** transposase * ec number: ** [h...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12366 CPD-12366] == * smiles: ** C(OP(=O)([O-])OP(=O)(OP([O-])([O-])=O)[O-])C1(OC(C(O)C(O)1...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12366 CPD-12366] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(OP(=O)([O-])OP(=O)(OP([O-])([O-])=O)[O-])C1(OC(C(O)C(O)1)N3(C(=O)NC2(C(=O)NC(N)=NC=23))) |
* common name: | * common name: | ||
| − | ** | + | ** 8-oxo-GTP |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=JCHLKIQZUXYLPW-UMMCILCDSA-J |
| + | * molecular weight: | ||
| + | ** 535.151 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** 8-oxo-guanosine-triphosphate | ||
| − | == Reaction | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-11409]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | * [[ | + | |
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | + | * PUBCHEM: | |
| − | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173271 46173271] | |
| − | {{#set: | + | {{#set: smiles=C(OP(=O)([O-])OP(=O)(OP([O-])([O-])=O)[O-])C1(OC(C(O)C(O)1)N3(C(=O)NC2(C(=O)NC(N)=NC=23)))}} |
| − | {{#set: | + | {{#set: common name=8-oxo-GTP}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=JCHLKIQZUXYLPW-UMMCILCDSA-J}} |
| − | {{#set: | + | {{#set: molecular weight=535.151 }} |
| − | {{#set: | + | {{#set: common name=8-oxo-guanosine-triphosphate}} |
| − | {{#set: | + | {{#set: produced by=RXN-11409}} |
Latest revision as of 20:13, 21 March 2018
Contents
Metabolite CPD-12366
- smiles:
- C(OP(=O)([O-])OP(=O)(OP([O-])([O-])=O)[O-])C1(OC(C(O)C(O)1)N3(C(=O)NC2(C(=O)NC(N)=NC=23)))
- common name:
- 8-oxo-GTP
- inchi key:
- InChIKey=JCHLKIQZUXYLPW-UMMCILCDSA-J
- molecular weight:
- 535.151
- Synonym(s):
- 8-oxo-guanosine-triphosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"C(OP(=O)([O-])OP(=O)(OP([O-])([O-])=O)[O-])C1(OC(C(O)C(O)1)N3(C(=O)NC2(C(=O)NC(N)=NC=23)))" cannot be used as a page name in this wiki.
