Difference between revisions of "RXN-17927"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FMN FMN] == * smiles: ** CC2(=CC1(N=C3(C(=O)[N-]C(=O)N=C(N(CC(O)C(O)C(O)COP([O-])(=O)[O-])C=1C=...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17927 RXN-17927] == * direction: ** LEFT-TO-RIGHT * common name: ** gtp-binding_protein * Synon...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FMN FMN] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17927 RXN-17927] ==
* smiles:
+
* direction:
** CC2(=CC1(N=C3(C(=O)[N-]C(=O)N=C(N(CC(O)C(O)C(O)COP([O-])(=O)[O-])C=1C=C(C)2)3)))
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=ANKZYBDXHMZBDK-SCRDCRAPSA-K
+
 
* common name:
 
* common name:
** FMN
+
** gtp-binding_protein
* molecular weight:
+
** 453.324   
+
 
* Synonym(s):
 
* Synonym(s):
** flavin mononucleotide
 
** riboflavin 5'-phosphate
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[FADSYN-RXN]]
+
* With identifiers:
* [[RXN0-5187]]
+
** 1 [[3Prime-OH-Terminated-RNAs]][c] '''+''' 1 [[A-5-prime-PP-5-prime-RNA]][c] '''=>''' 1 [[AMP]][c] '''+''' 1 [[RNAs]][c] '''+''' 1 [[PROTON]][c]
== Reaction(s) known to produce the compound ==
+
* With common name(s):
* [[RIBOFLAVINKIN-RXN]]
+
** 1 an [RNA]-3'-hydroxyl[c] '''+''' 1 a 5'-(5'-diphosphoadenosine)-(ribonucleoside)-[RNA][c] '''=>''' 1 AMP[c] '''+''' 1 a ribonucleic acid[c] '''+''' 1 H+[c]
* [[ARPT]]
+
 
== Reaction(s) of unknown directionality ==
+
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_8396]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_8397]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_8398]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* CAS : 146-17-8
+
{{#set: direction=LEFT-TO-RIGHT}}
* Wikipedia : Flavin_mononucleotide
+
{{#set: common name=gtp-binding_protein}}
* METABOLIGHTS : MTBLC58210
+
{{#set: gene associated=Tiso_gene_8396|Tiso_gene_8397|Tiso_gene_8398}}
* PUBCHEM:
+
{{#set: in pathway=}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44229199 44229199]
+
{{#set: reconstruction category=annotation}}
* HMDB : HMDB01520
+
{{#set: reconstruction source=annotation-in-silico_annotation}}
* LIGAND-CPD:
+
{{#set: reconstruction tool=pathwaytools}}
** [http://www.genome.jp/dbget-bin/www_bget?C00061 C00061]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58210 58210]
+
* BIGG : fmn
+
{{#set: smiles=CC2(=CC1(N=C3(C(=O)[N-]C(=O)N=C(N(CC(O)C(O)C(O)COP([O-])(=O)[O-])C=1C=C(C)2)3)))}}
+
{{#set: inchi key=InChIKey=ANKZYBDXHMZBDK-SCRDCRAPSA-K}}
+
{{#set: common name=FMN}}
+
{{#set: molecular weight=453.324    }}
+
{{#set: common name=flavin mononucleotide|riboflavin 5'-phosphate}}
+
{{#set: consumed by=FADSYN-RXN|RXN0-5187}}
+
{{#set: produced by=RIBOFLAVINKIN-RXN|ARPT}}
+

Latest revision as of 20:13, 21 March 2018

Reaction RXN-17927

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • gtp-binding_protein
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links