Difference between revisions of "PWY-4821"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ISOBUTYRYL-COA ISOBUTYRYL-COA] == * smiles: ** CC(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-4821 PWY-4821] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-82115 TAX-8...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ISOBUTYRYL-COA ISOBUTYRYL-COA] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-4821 PWY-4821] ==
−
* smiles:
+
* taxonomic range:
−
** CC(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])C
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-82115 TAX-82115]
−
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
−
** InChIKey=AEWHYWSPVRZHCT-NDZSKPAWSA-J
+
 
* common name:
 
* common name:
−
** isobutanoyl-CoA
+
** UDP-D-xylose biosynthesis
−
* molecular weight:
+
−
** 833.593   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 2-methylpropanoyl-CoA
+
** UDP-xylose biosynthesis
−
** isobutyryl-coenzyme A
+
** UDPXyl biosynthesis
−
** 2-methylpropionyl-CoA
+
−
** S-(2-methylpropanoyl)-CoA
+
−
** isobutyryl-CoA
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[MEPROPCOA-FAD-RXN]]
+
'''1''' reactions found over '''3''' reactions in the full pathway
−
* [[MCDH]]
+
* [[UDP-GLUCURONATE-DECARBOXYLASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** 1 associated gene(s):
−
* [[DHRT_ibcoa]]
+
*** [[Tiso_gene_12394]]
−
* [[1.2.1.25-RXN]]
+
** 1 reconstruction source(s) associated:
−
== Reaction(s) of unknown directionality ==
+
*** [[orthology-esiliculosus]]
−
* [[2.3.1.168-RXN]]
+
== Reaction(s) not found ==
−
* [[RXN-13671]]
+
* [http://metacyc.org/META/NEW-IMAGE?object=PWY-7346 PWY-7346]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=PWY-7346 PWY-7346]
 
== External links  ==
 
== External links  ==
−
* CAS : 15621-60-0
+
* ARACYC:
−
* PUBCHEM:
+
** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-4821 PWY-4821]
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266570 45266570]
+
{{#set: taxonomic range=TAX-82115}}
−
* HMDB : HMDB01243
+
{{#set: taxonomic range=TAX-2759}}
−
* LIGAND-CPD:
+
{{#set: common name=UDP-D-xylose biosynthesis}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00630 C00630]
+
{{#set: common name=UDP-xylose biosynthesis|UDPXyl biosynthesis}}
−
* CHEBI:
+
{{#set: reaction found=1}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57338 57338]
+
{{#set: total reaction=3}}
−
* METABOLIGHTS : MTBLC57338
+
{{#set: completion rate=33.0}}
−
{{#set: smiles=CC(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])C}}
+
−
{{#set: inchi key=InChIKey=AEWHYWSPVRZHCT-NDZSKPAWSA-J}}
+
−
{{#set: common name=isobutanoyl-CoA}}
+
−
{{#set: molecular weight=833.593    }}
+
−
{{#set: common name=2-methylpropanoyl-CoA|isobutyryl-coenzyme A|2-methylpropionyl-CoA|S-(2-methylpropanoyl)-CoA|isobutyryl-CoA}}
+
−
{{#set: consumed by=MEPROPCOA-FAD-RXN|MCDH}}
+
−
{{#set: produced by=DHRT_ibcoa|1.2.1.25-RXN}}
+
−
{{#set: consumed or produced by=2.3.1.168-RXN|RXN-13671}}
+

Latest revision as of 19:13, 21 March 2018

Pathway PWY-4821

  • taxonomic range:
  • common name:
    • UDP-D-xylose biosynthesis
  • Synonym(s):
    • UDP-xylose biosynthesis
    • UDPXyl biosynthesis

Reaction(s) found

1 reactions found over 3 reactions in the full pathway

Reaction(s) not found

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=PWY-4821&oldid=40273"