Difference between revisions of "Guanine9-in-tRNA"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PREPHENATE PREPHENATE] == * smiles: ** C(=O)([O-])C(=O)CC1(C(=O)[O-])(C=CC(O)C=C1) * inchi key:...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Guanine9-in-tRNA Guanine9-in-tRNA] == * common name: ** a guanine9 in tRNA * Synonym(s): == Re...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Guanine9-in-tRNA Guanine9-in-tRNA] == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** a guanine9 in tRNA |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-12459]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
− | |||
== External links == | == External links == | ||
− | + | {{#set: common name=a guanine9 in tRNA}} | |
− | + | {{#set: consumed by=RXN-12459}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: common name= | + | |
− | + | ||
− | {{#set: consumed by= | + | |
− | + |
Latest revision as of 19:13, 21 March 2018
Contents
Metabolite Guanine9-in-tRNA
- common name:
- a guanine9 in tRNA
- Synonym(s):