Difference between revisions of "PWY-6823"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SULFO-CYSTEINE SULFO-CYSTEINE] == * smiles: ** C(C([N+])C(=O)[O-])SS([O-])(=O)=O * inchi key: *...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6823 PWY-6823] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-21...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6823 PWY-6823] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157] |
− | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759] |
* common name: | * common name: | ||
− | ** | + | ** molybdenum cofactor biosynthesis |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** moco biosynthesis |
+ | ** molybdopterin biosynthesis | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | + | '''3''' reactions found over '''8''' reactions in the full pathway | |
− | == Reaction(s) | + | * [[RXN-8340]] |
− | * [[ | + | ** 1 associated gene(s): |
+ | *** [[Tiso_gene_7986]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | * [[RXN-8348]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Tiso_gene_17329]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | * [[RXN0-308]] | ||
+ | ** 3 associated gene(s): | ||
+ | *** [[Tiso_gene_4284]] | ||
+ | *** [[Tiso_gene_11478]] | ||
+ | *** [[Tiso_gene_14710]] | ||
+ | ** 3 reconstruction source(s) associated: | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-11361 RXN-11361] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-12473 RXN-12473] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-17809 RXN-17809] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8342 RXN-8342] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8344 RXN-8344] | ||
== External links == | == External links == | ||
− | * | + | * ECOCYC: |
− | ** [http:// | + | ** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY-6823 PWY-6823] |
− | + | {{#set: taxonomic range=TAX-2157}} | |
− | + | {{#set: taxonomic range=TAX-2}} | |
− | + | {{#set: taxonomic range=TAX-2759}} | |
− | + | {{#set: common name=molybdenum cofactor biosynthesis}} | |
− | + | {{#set: common name=moco biosynthesis|molybdopterin biosynthesis}} | |
− | {{#set: | + | {{#set: reaction found=3}} |
− | {{#set: | + | {{#set: total reaction=8}} |
− | {{#set: common name= | + | {{#set: completion rate=38.0}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:13, 21 March 2018
Pathway PWY-6823
- taxonomic range:
- common name:
- molybdenum cofactor biosynthesis
- Synonym(s):
- moco biosynthesis
- molybdopterin biosynthesis
Reaction(s) found
3 reactions found over 8 reactions in the full pathway
- RXN-8340
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-8348
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN0-308
- 3 associated gene(s):
- 3 reconstruction source(s) associated:
Reaction(s) not found
External links
- ECOCYC: