Difference between revisions of "CPD-14877"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1303 PWY0-1303] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14877 CPD-14877] == * smiles: ** CC(=O)NC1(=CC(C([O-])=O)=CC=C(O)1) * common name: ** 3-ace...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14877 CPD-14877] == |
| − | * | + | * smiles: |
| − | ** [ | + | ** CC(=O)NC1(=CC(C([O-])=O)=CC=C(O)1) |
* common name: | * common name: | ||
| − | ** | + | ** 3-acetylamino-4-hydroxybenzoate |
| + | * inchi key: | ||
| + | ** InChIKey=BXBFVCYLJXGOGI-UHFFFAOYSA-M | ||
| + | * molecular weight: | ||
| + | ** 194.166 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** 3-acetylamino-4-hydroxybenzoic acid | ||
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | * [[RXN-13870]] | |
| − | == Reaction(s) | + | |
| − | * | + | |
== External links == | == External links == | ||
| − | * | + | * PUBCHEM: |
| − | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657256 90657256] |
| − | {{#set: | + | {{#set: smiles=CC(=O)NC1(=CC(C([O-])=O)=CC=C(O)1)}} |
| − | {{#set: common name= | + | {{#set: common name=3-acetylamino-4-hydroxybenzoate}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=BXBFVCYLJXGOGI-UHFFFAOYSA-M}} |
| − | {{#set: reaction | + | {{#set: molecular weight=194.166 }} |
| + | {{#set: common name=3-acetylamino-4-hydroxybenzoic acid}} | ||
| + | {{#set: reversible reaction associated=RXN-13870}} | ||
Latest revision as of 20:14, 21 March 2018
Contents
Metabolite CPD-14877
- smiles:
- CC(=O)NC1(=CC(C([O-])=O)=CC=C(O)1)
- common name:
- 3-acetylamino-4-hydroxybenzoate
- inchi key:
- InChIKey=BXBFVCYLJXGOGI-UHFFFAOYSA-M
- molecular weight:
- 194.166
- Synonym(s):
- 3-acetylamino-4-hydroxybenzoic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CC(=O)NC1(=CC(C([O-])=O)=CC=C(O)1)" cannot be used as a page name in this wiki.
