Difference between revisions of "E-"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2105 CPD0-2105] == * smiles: ** CCCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=E- E-] == * Synonym(s): == Reaction(s) known to consume the compound == * RXN-16333 * RX...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2105 CPD0-2105] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=E- E-] ==
−
* smiles:
+
−
** CCCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
−
* inchi key:
+
−
** InChIKey=HQANBZHVWIDNQZ-GMHMEAMDSA-J
+
−
* common name:
+
−
** 3-oxododecanoyl-CoA
+
−
* molecular weight:
+
−
** 959.791   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 3-oxolauroyl-CoA
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-16333]]
 +
* [[RXN-924]]
 +
* [[RXN0-7005]]
 +
* [[RXN0-6490]]
 +
* [[RXN-17758]]
 +
* [[RXN0-5259]]
 +
* [[RXN-15468]]
 +
* [[RXN0-5248]]
 +
* [[RXN0-5265]]
 +
* [[RXN-15447]]
 +
* [[RXN-15831]]
 +
* [[RXN0-5244]]
 +
* [[RXN-15815]]
 +
* [[RXN0-5254]]
 +
* [[RXN0-5257]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
* [[HACD5m]]
 
−
* [[RXN-14274]]
 
−
* [[HACD5]]
 
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: consumed by=RXN-16333|RXN-924|RXN0-7005|RXN0-6490|RXN-17758|RXN0-5259|RXN-15468|RXN0-5248|RXN0-5265|RXN-15447|RXN-15831|RXN0-5244|RXN-15815|RXN0-5254|RXN0-5257}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C05263 C05263]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62615 62615]
+
−
* BIGG : 3oddcoa
+
−
* PUBCHEM:
+
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173506 46173506]
+
−
* HMDB : HMDB03937
+
−
{{#set: smiles=CCCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
−
{{#set: inchi key=InChIKey=HQANBZHVWIDNQZ-GMHMEAMDSA-J}}
+
−
{{#set: common name=3-oxododecanoyl-CoA}}
+
−
{{#set: molecular weight=959.791    }}
+
−
{{#set: common name=3-oxolauroyl-CoA}}
+
−
{{#set: consumed or produced by=HACD5m|RXN-14274|HACD5}}
+

Latest revision as of 19:14, 21 March 2018

Metabolite E-

  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=E-&oldid=40361"