Difference between revisions of "E-"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11404 CPD-11404] == * smiles: ** C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC2(=CC(I)=C(O)C=C2)) * in...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=E- E-] == * Synonym(s): == Reaction(s) known to consume the compound == * RXN-16333 * RX...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=E- E-] == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-16333]] |
− | * [[RXN- | + | * [[RXN-924]] |
+ | * [[RXN0-7005]] | ||
+ | * [[RXN0-6490]] | ||
+ | * [[RXN-17758]] | ||
+ | * [[RXN0-5259]] | ||
+ | * [[RXN-15468]] | ||
+ | * [[RXN0-5248]] | ||
+ | * [[RXN0-5265]] | ||
+ | * [[RXN-15447]] | ||
+ | * [[RXN-15831]] | ||
+ | * [[RXN0-5244]] | ||
+ | * [[RXN-15815]] | ||
+ | * [[RXN0-5254]] | ||
+ | * [[RXN0-5257]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | + | {{#set: consumed by=RXN-16333|RXN-924|RXN0-7005|RXN0-6490|RXN-17758|RXN0-5259|RXN-15468|RXN0-5248|RXN0-5265|RXN-15447|RXN-15831|RXN0-5244|RXN-15815|RXN0-5254|RXN0-5257}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + |
Latest revision as of 20:14, 21 March 2018
Contents
Metabolite E-
- Synonym(s):
Reaction(s) known to consume the compound
- RXN-16333
- RXN-924
- RXN0-7005
- RXN0-6490
- RXN-17758
- RXN0-5259
- RXN-15468
- RXN0-5248
- RXN0-5265
- RXN-15447
- RXN-15831
- RXN0-5244
- RXN-15815
- RXN0-5254
- RXN0-5257