Difference between revisions of "Tiso gene 11070"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10826 CPD-10826] == * smiles: ** CC(C(=O)CC(=O)[O-])CC(=O)[O-] * inchi key: ** InChIKey=HKH...")
 
(Created page with "Category:Gene == Gene Tiso_gene_11070 == * right end position: ** 8073 * transcription direction: ** POSITIVE * left end position: ** 6524 * centisome position: ** 80.8125...")
 
(4 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10826 CPD-10826] ==
+
== Gene Tiso_gene_11070 ==
* smiles:
+
* right end position:
** CC(C(=O)CC(=O)[O-])CC(=O)[O-]
+
** 8073
* inchi key:
+
* transcription direction:
** InChIKey=HKHNBKNLBZMXIV-UHFFFAOYSA-L
+
** POSITIVE
* common name:
+
* left end position:
** 4-methyl-3-oxoadipate
+
** 6524
* molecular weight:
+
* centisome position:
** 172.137    
+
** 80.812584    
 
* Synonym(s):
 
* Synonym(s):
** 4-methyl-3-ketoadipate
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* Reaction: [[PEPTIDYLPROLYL-ISOMERASE-RXN]]
* [[RXN-10083]]
+
** Source: [[annotation-in-silico_annotation]]
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: right end position=8073}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44123441 44123441]
+
{{#set: transcription direction=POSITIVE}}
{{#set: smiles=CC(C(=O)CC(=O)[O-])CC(=O)[O-]}}
+
{{#set: left end position=6524}}
{{#set: inchi key=InChIKey=HKHNBKNLBZMXIV-UHFFFAOYSA-L}}
+
{{#set: centisome position=80.812584   }}
{{#set: common name=4-methyl-3-oxoadipate}}
+
{{#set: reaction associated=PEPTIDYLPROLYL-ISOMERASE-RXN}}
{{#set: molecular weight=172.137   }}
+
{{#set: common name=4-methyl-3-ketoadipate}}
+
{{#set: produced by=RXN-10083}}
+

Latest revision as of 19:14, 21 March 2018

Gene Tiso_gene_11070

  • right end position:
    • 8073
  • transcription direction:
    • POSITIVE
  • left end position:
    • 6524
  • centisome position:
    • 80.812584
  • Synonym(s):

Reactions associated

Pathways associated

External links