Difference between revisions of "Tiso gene 11070"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10826 CPD-10826] == * smiles: ** CC(C(=O)CC(=O)[O-])CC(=O)[O-] * inchi key: ** InChIKey=HKH...") |
(Created page with "Category:Gene == Gene Tiso_gene_11070 == * right end position: ** 8073 * transcription direction: ** POSITIVE * left end position: ** 6524 * centisome position: ** 80.8125...") |
||
(4 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_11070 == |
− | * | + | * right end position: |
− | ** | + | ** 8073 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 6524 |
− | * | + | * centisome position: |
− | ** | + | ** 80.812584 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[PEPTIDYLPROLYL-ISOMERASE-RXN]] | |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | == | + | *** Assignment: automated-name-match |
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=8073}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | {{#set: | + | {{#set: left end position=6524}} |
− | {{#set: | + | {{#set: centisome position=80.812584 }} |
− | {{#set: | + | {{#set: reaction associated=PEPTIDYLPROLYL-ISOMERASE-RXN}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 20:14, 21 March 2018
Gene Tiso_gene_11070
- right end position:
- 8073
- transcription direction:
- POSITIVE
- left end position:
- 6524
- centisome position:
- 80.812584
- Synonym(s):
Reactions associated
- Reaction: PEPTIDYLPROLYL-ISOMERASE-RXN
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: annotation-in-silico_annotation