Difference between revisions of "PWY-5041"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19163 CPD-19163] == * smiles: ** CCCCCCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5041 PWY-5041] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] **...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19163 CPD-19163] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5041 PWY-5041] ==
−
* smiles:
+
* taxonomic range:
−
** CCCCCCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
−
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
−
** InChIKey=OPMPWWFMNYWBGF-PKYBCSRXSA-J
+
 
* common name:
 
* common name:
−
** (2E,11Z)-octadecenoyl-CoA
+
** S-adenosyl-L-methionine cycle II
−
* molecular weight:
+
−
** 1025.937   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 18:2-Δ2,Δ11-CoA
+
** activated methyl cycle
−
** 2-trans,11-cis-octadecenoyl-CoA
+
** SAM cycle
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
'''4''' reactions found over '''4''' reactions in the full pathway
−
* [[RXN-17784]]
+
* [[ADENOSYLHOMOCYSTEINASE-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** 1 associated gene(s):
 +
*** [[Tiso_gene_14191]]
 +
** 7 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-synechocystis]]
 +
*** [[manual-primary_network]]
 +
*** [[orthology-creinhardtii]]
 +
* [[HOMOCYSMET-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_1602]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[annotation-experimental_annotation]]
 +
* [[RXN-7605]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
* [[S-ADENMETSYN-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_13443]]
 +
** 6 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-synechocystis]]
 +
*** [[manual-primary_network]]
 +
*** [[orthology-creinhardtii]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
−
{{#set: smiles=CCCCCCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
* ARACYC:
−
{{#set: inchi key=InChIKey=OPMPWWFMNYWBGF-PKYBCSRXSA-J}}
+
** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-5041 PWY-5041]
−
{{#set: common name=(2E,11Z)-octadecenoyl-CoA}}
+
{{#set: taxonomic range=TAX-2}}
−
{{#set: molecular weight=1025.937    }}
+
{{#set: taxonomic range=TAX-2759}}
−
{{#set: common name=18:2-Δ2,Δ11-CoA|2-trans,11-cis-octadecenoyl-CoA}}
+
{{#set: common name=S-adenosyl-L-methionine cycle II}}
−
{{#set: produced by=RXN-17784}}
+
{{#set: common name=activated methyl cycle|SAM cycle}}
 +
{{#set: reaction found=4}}
 +
{{#set: total reaction=4}}
 +
{{#set: completion rate=100.0}}

Latest revision as of 19:14, 21 March 2018

Pathway PWY-5041

  • taxonomic range:
  • common name:
    • S-adenosyl-L-methionine cycle II
  • Synonym(s):
    • activated methyl cycle
    • SAM cycle

Reaction(s) found

4 reactions found over 4 reactions in the full pathway

Reaction(s) not found

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=PWY-5041&oldid=40380"