Difference between revisions of "CPD-19163"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PROTEIN-N-UBIQUITYL-LYSINE PROTEIN-N-UBIQUITYL-LYSINE] == * common name: ** an N6-monoubiquitin...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19163 CPD-19163] == * smiles: ** CCCCCCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19163 CPD-19163] == |
| + | * smiles: | ||
| + | ** CCCCCCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] | ||
* common name: | * common name: | ||
| − | ** | + | ** (2E,11Z)-octadecenoyl-CoA |
| + | * inchi key: | ||
| + | ** InChIKey=OPMPWWFMNYWBGF-PKYBCSRXSA-J | ||
| + | * molecular weight: | ||
| + | ** 1025.937 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** 18:2-Δ2,Δ11-CoA | ||
| + | ** 2-trans,11-cis-octadecenoyl-CoA | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-17784]] |
| − | + | ||
| − | + | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | {{#set: | + | {{#set: smiles=CCCCCCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} |
| − | {{#set: | + | {{#set: common name=(2E,11Z)-octadecenoyl-CoA}} |
| + | {{#set: inchi key=InChIKey=OPMPWWFMNYWBGF-PKYBCSRXSA-J}} | ||
| + | {{#set: molecular weight=1025.937 }} | ||
| + | {{#set: common name=18:2-Δ2,Δ11-CoA|2-trans,11-cis-octadecenoyl-CoA}} | ||
| + | {{#set: produced by=RXN-17784}} | ||
Latest revision as of 19:14, 21 March 2018
Contents
Metabolite CPD-19163
- smiles:
- CCCCCCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- common name:
- (2E,11Z)-octadecenoyl-CoA
- inchi key:
- InChIKey=OPMPWWFMNYWBGF-PKYBCSRXSA-J
- molecular weight:
- 1025.937
- Synonym(s):
- 18:2-Δ2,Δ11-CoA
- 2-trans,11-cis-octadecenoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.
