Difference between revisions of "Tiso gene 12892"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2105 CPD0-2105] == * smiles: ** CCCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP...")
(Created page with "Category:Gene == Gene Tiso_gene_12892 == * right end position: ** 4800 * transcription direction: ** POSITIVE * left end position: ** 3018 * centisome position: ** 45.3629...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2105 CPD0-2105] ==
+
== Gene Tiso_gene_12892 ==
−
* smiles:
+
* right end position:
−
** CCCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 4800
−
* inchi key:
+
* transcription direction:
−
** InChIKey=HQANBZHVWIDNQZ-GMHMEAMDSA-J
+
** POSITIVE
−
* common name:
+
* left end position:
−
** 3-oxododecanoyl-CoA
+
** 3018
−
* molecular weight:
+
* centisome position:
−
** 959.791    
+
** 45.362995    
 
* Synonym(s):
 
* Synonym(s):
−
** 3-oxolauroyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[3.2.1.6-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-in-silico_annotation]]
−
* [[HACD5m]]
+
*** Assignment: ec-number
−
* [[RXN-14274]]
+
* Reaction: [[3.2.1.73-RXN]]
−
* [[HACD5]]
+
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[QUINOPRIBOTRANS-RXN]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY-5316]]
 +
* [[PWY-5653]]
 +
* [[PYRIDNUCSYN-PWY]]
 +
* [[PWY-7342]]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: right end position=4800}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C05263 C05263]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: left end position=3018}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62615 62615]
+
{{#set: centisome position=45.362995   }}
−
* BIGG : 3oddcoa
+
{{#set: reaction associated=3.2.1.6-RXN|3.2.1.73-RXN|QUINOPRIBOTRANS-RXN}}
−
* PUBCHEM:
+
{{#set: pathway associated=PWY-5316|PWY-5653|PYRIDNUCSYN-PWY|PWY-7342}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173506 46173506]
+
−
* HMDB : HMDB03937
+
−
{{#set: smiles=CCCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
−
{{#set: inchi key=InChIKey=HQANBZHVWIDNQZ-GMHMEAMDSA-J}}
+
−
{{#set: common name=3-oxododecanoyl-CoA}}
+
−
{{#set: molecular weight=959.791   }}
+
−
{{#set: common name=3-oxolauroyl-CoA}}
+
−
{{#set: reversible reaction associated=HACD5m|RXN-14274|HACD5}}
+

Latest revision as of 19:14, 21 March 2018

Gene Tiso_gene_12892

  • right end position:
    • 4800
  • transcription direction:
    • POSITIVE
  • left end position:
    • 3018
  • centisome position:
    • 45.362995
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_12892&oldid=40398"