Difference between revisions of "Tiso gene 15682"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10826 CPD-10826] == * smiles: ** CC(C(=O)CC(=O)[O-])CC(=O)[O-] * inchi key: ** InChIKey=HKH...") |
(Created page with "Category:Gene == Gene Tiso_gene_15682 == * Synonym(s): == Reactions associated == * Reaction: CYTOCHROME-C-OXIDASE-RXN ** Source: orthology-esiliculosus * Reactio...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_15682 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[CYTOCHROME-C-OXIDASE-RXN]] | |
− | * [[RXN- | + | ** Source: [[orthology-esiliculosus]] |
− | == | + | * Reaction: [[RXN-15830]] |
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY-6692]] | ||
+ | * [[PWY-7279]] | ||
+ | * [[PWY-3781]] | ||
+ | * [[PWY-4521]] | ||
== External links == | == External links == | ||
− | + | {{#set: reaction associated=CYTOCHROME-C-OXIDASE-RXN|RXN-15830}} | |
− | + | {{#set: pathway associated=PWY-6692|PWY-7279|PWY-3781|PWY-4521}} | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + |
Latest revision as of 20:15, 21 March 2018
Gene Tiso_gene_15682
- Synonym(s):
Reactions associated
- Reaction: CYTOCHROME-C-OXIDASE-RXN
- Source: orthology-esiliculosus
- Reaction: RXN-15830
- Source: orthology-esiliculosus