Difference between revisions of "RXN-3701"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-138 CPD1F-138] == * smiles: ** C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C)([CH](CC2)3)4)C([O-])=...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-3701 RXN-3701] == * direction: ** REVERSIBLE * common name: ** rab_proteins_geranylgeranyltrans...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-138 CPD1F-138] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-3701 RXN-3701] ==
* smiles:
+
* direction:
** C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C)([CH](CC2)3)4)C([O-])=O))C=O)))
+
** REVERSIBLE
* inchi key:
+
** InChIKey=ZCTUNYRXJKLWPY-LLCOKINKSA-M
+
 
* common name:
 
* common name:
** gibberellin A12-aldehyde
+
** rab_proteins_geranylgeranyltransferase_component_a_2
* molecular weight:
+
** protein_geranylgeranyltransferase_type_ii
** 315.431   
+
* ec number:
 +
** [http://enzyme.expasy.org/EC/2.5.1.60 EC-2.5.1.60]
 +
** [http://enzyme.expasy.org/EC/2.5.1.59 EC-2.5.1.59]
 
* Synonym(s):
 
* Synonym(s):
** GA12-aldehyde
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN1F-161]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[GERANYLGERANYL-PP]][c] '''+''' 1 [[PROT-CYS]][c] '''<=>''' 1 [[PPI]][c] '''+''' 1 [[S-GERANYLGERANYL-PROTEIN]][c]
* [[RXN1F-160]]
+
* With common name(s):
== Reaction(s) of unknown directionality ==
+
** 1 geranylgeranyl diphosphate[c] '''+''' 1 a [protein]-L-cysteine[c] '''<=>''' 1 diphosphate[c] '''+''' 1 a [protein]-S-geranylgeranyl-L-cysteine[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_18628]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_18627]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_18785]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=REVERSIBLE}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244417 25244417]
+
{{#set: common name=rab_proteins_geranylgeranyltransferase_component_a_2}}
* CHEBI:
+
{{#set: common name=protein_geranylgeranyltransferase_type_ii}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57432 57432]
+
{{#set: ec number=EC-2.5.1.60}}
* LIGAND-CPD:
+
{{#set: ec number=EC-2.5.1.59}}
** [http://www.genome.jp/dbget-bin/www_bget?C06093 C06093]
+
{{#set: gene associated=Tiso_gene_18628|Tiso_gene_18627|Tiso_gene_18785}}
* HMDB : HMDB39484
+
{{#set: in pathway=}}
{{#set: smiles=C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C)([CH](CC2)3)4)C([O-])=O))C=O)))}}
+
{{#set: reconstruction category=orthology|annotation}}
{{#set: inchi key=InChIKey=ZCTUNYRXJKLWPY-LLCOKINKSA-M}}
+
{{#set: reconstruction source=annotation-in-silico_annotation|orthology-esiliculosus}}
{{#set: common name=gibberellin A12-aldehyde}}
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
{{#set: molecular weight=315.431    }}
+
{{#set: common name=GA12-aldehyde}}
+
{{#set: consumed by=RXN1F-161}}
+
{{#set: produced by=RXN1F-160}}
+

Latest revision as of 20:15, 21 March 2018

Reaction RXN-3701

  • direction:
    • REVERSIBLE
  • common name:
    • rab_proteins_geranylgeranyltransferase_component_a_2
    • protein_geranylgeranyltransferase_type_ii
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links