Difference between revisions of "RXN3DJ-11230"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13758 CPD-13758] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CC(=O)C1(C(O)CCC2(C)(C(=O)...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN3DJ-11230 RXN3DJ-11230] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.o...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13758 CPD-13758] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN3DJ-11230 RXN3DJ-11230] ==
−
* smiles:
+
* direction:
−
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CC(=O)C1(C(O)CCC2(C)(C(=O)CC[CH]12)))COP(=O)(OP(=O)(OCC3(C(OP([O-])(=O)[O-])C(O)C(O3)N5(C4(=C(C(N)=NC=N4)N=C5))))[O-])[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=OGAHROYMEOBORV-XONGILKKSA-J
+
** [http://enzyme.expasy.org/EC/4.3.2 EC-4.3.2]
−
* common name:
+
−
** 3-[(3aS,4S,5R,7aS)-5-hydroxy-7a-methyl-1-oxo-octahydro-1H-inden-4-yl]-3-oxopropanoyl-CoA
+
−
* molecular weight:
+
−
** 999.769   
+
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-12750]]
+
** 1 [[CPD3DJ-11366]][c] '''=>''' 1 [[PHOSPHORYL-ETHANOLAMINE]][c] '''+''' 1 [[CPD-292]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 sphingosine 1-phosphate[c] '''=>''' 1 O-phosphoethanolamine[c] '''+''' 1 (2E)-hexadecenal[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_105]]
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
* [[PWY3DJ-11470]], sphingosine and sphingosine-1-phosphate metabolism: [http://metacyc.org/META/NEW-IMAGE?object=PWY3DJ-11470 PWY3DJ-11470]
 +
** '''3''' reactions found over '''5''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-athaliana]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* RHEA:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657507 90657507]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=33508 33508]
−
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CC(=O)C1(C(O)CCC2(C)(C(=O)CC[CH]12)))COP(=O)(OP(=O)(OCC3(C(OP([O-])(=O)[O-])C(O)C(O3)N5(C4(=C(C(N)=NC=N4)N=C5))))[O-])[O-]}}
+
* LIGAND-RXN:
−
{{#set: inchi key=InChIKey=OGAHROYMEOBORV-XONGILKKSA-J}}
+
** [http://www.genome.jp/dbget-bin/www_bget?R06516 R06516]
−
{{#set: common name=3-[(3aS,4S,5R,7aS)-5-hydroxy-7a-methyl-1-oxo-octahydro-1H-inden-4-yl]-3-oxopropanoyl-CoA}}
+
{{#set: direction=LEFT-TO-RIGHT}}
−
{{#set: molecular weight=999.769    }}
+
{{#set: ec number=EC-4.3.2}}
−
{{#set: produced by=RXN-12750}}
+
{{#set: gene associated=Tiso_gene_105}}
 +
{{#set: in pathway=PWY3DJ-11470}}
 +
{{#set: reconstruction category=orthology}}
 +
{{#set: reconstruction source=orthology-athaliana|orthology-esiliculosus}}
 +
{{#set: reconstruction tool=pantograph}}

Latest revision as of 19:15, 21 March 2018

Reaction RXN3DJ-11230

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY3DJ-11470, sphingosine and sphingosine-1-phosphate metabolism: PWY3DJ-11470
    • 3 reactions found over 5 reactions in the full pathway

Reconstruction information

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN3DJ-11230&oldid=40435"