Difference between revisions of "PWY-5517"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-SULFINYL-PYRUVATE 3-SULFINYL-PYRUVATE] == * smiles: ** C(S([O-])=O)C(=O)C(=O)[O-] * inchi key...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5517 PWY-5517] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5517 PWY-5517] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** L-arabinose degradation III |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | + | '''1''' reactions found over '''6''' reactions in the full pathway | |
| − | == Reaction(s) | + | * [[RXN-14809]] |
| − | * [[ | + | ** 0 associated gene: |
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-in-silico_annotation]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=4.2.1.43-RXN 4.2.1.43-RXN] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=L-ARABINONATE-DEHYDRATASE-RXN L-ARABINONATE-DEHYDRATASE-RXN] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=L-ARABINONOLACTONASE-RXN L-ARABINONOLACTONASE-RXN] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8774 RXN-8774] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8775 RXN-8775] | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-2}} | |
| − | + | {{#set: common name=L-arabinose degradation III}} | |
| − | + | {{#set: reaction found=1}} | |
| − | + | {{#set: total reaction=6}} | |
| − | + | {{#set: completion rate=17.0}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:15, 21 March 2018
Pathway PWY-5517
- taxonomic range:
- common name:
- L-arabinose degradation III
- Synonym(s):
Reaction(s) found
1 reactions found over 6 reactions in the full pathway
- RXN-14809
- 0 associated gene:
- 1 reconstruction source(s) associated:
