Difference between revisions of "Tiso gene 2508"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8058 CPD-8058] == * smiles: ** COC1(C(C(C(C(C1O)O)O)O)OC2(C(C(C(C(O2)CO)O)O)O)) * inchi key...") |
(Created page with "Category:Gene == Gene Tiso_gene_2508 == * Synonym(s): == Reactions associated == * Reaction: 1.14.19.3-RXN ** Source: orthology-esiliculosus == Pathways associate...") |
||
| (4 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Gene]] |
| − | == | + | == Gene Tiso_gene_2508 == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | == | + | == Reactions associated == |
| − | + | * Reaction: [[1.14.19.3-RXN]] | |
| − | * [[ | + | ** Source: [[orthology-esiliculosus]] |
| − | == | + | == Pathways associated == |
| + | * [[PWY-6000]] | ||
== External links == | == External links == | ||
| − | + | {{#set: reaction associated=1.14.19.3-RXN}} | |
| − | + | {{#set: pathway associated=PWY-6000}} | |
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
Latest revision as of 19:15, 21 March 2018
Gene Tiso_gene_2508
- Synonym(s):
Reactions associated
- Reaction: 1.14.19.3-RXN
- Source: orthology-esiliculosus
