Difference between revisions of "CPD-13524"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12579 RXN-12579] == * direction: ** LEFT-TO-RIGHT * common name: ** ORF ** zinc_finger_fyve_dom...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13524 CPD-13524] == * smiles: ** CC(=CC=CC(C)=CCO)C=CC1(=C(C)CCCC(C)(C)1) * common name: **...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13524 CPD-13524] == |
− | * | + | * smiles: |
− | ** | + | ** CC(=CC=CC(C)=CCO)C=CC1(=C(C)CCCC(C)(C)1) |
* common name: | * common name: | ||
− | ** | + | ** all-trans-retinol |
− | + | * inchi key: | |
− | * | + | ** InChIKey=FPIPGXGPPPQFEQ-OVSJKPMPSA-N |
− | ** | + | * molecular weight: |
− | * | + | ** 286.456 |
− | ** | + | |
* Synonym(s): | * Synonym(s): | ||
+ | ** trans-retinol | ||
+ | ** retinol | ||
+ | ** vitamin A | ||
+ | ** vitamin A1 | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[1.3.99.23-RXN]] |
− | + | * [[RXN-12547]] | |
− | * | + | == Reaction(s) known to produce the compound == |
− | + | * [[RXN-12575]] | |
− | + | * [[3.1.1.64-RXN]] | |
− | == | + | * [[RXN-12579]] |
− | + | == Reaction(s) of unknown directionality == | |
− | * [[ | + | * [[RETINOL-DEHYDROGENASE-RXN]] |
− | + | ||
− | + | ||
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | * LIPID_MAPS : LMPR01090001 | |
− | + | * CAS : 68-26-8 | |
− | {{#set: | + | * CAS : 11103-57-4 |
− | {{#set: common name= | + | * Wikipedia : Retinol |
− | {{#set: | + | * DRUGBANK : DB00162 |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=445354 445354] |
− | {{#set: | + | * HMDB : HMDB00305 |
− | + | * LIGAND-CPD: | |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00473 C00473] |
− | {{#set: | + | * CHEMSPIDER: |
+ | ** [http://www.chemspider.com/Chemical-Structure.393012.html 393012] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17336 17336] | ||
+ | * METABOLIGHTS : MTBLC17336 | ||
+ | {{#set: smiles=CC(=CC=CC(C)=CCO)C=CC1(=C(C)CCCC(C)(C)1)}} | ||
+ | {{#set: common name=all-trans-retinol}} | ||
+ | {{#set: inchi key=InChIKey=FPIPGXGPPPQFEQ-OVSJKPMPSA-N}} | ||
+ | {{#set: molecular weight=286.456 }} | ||
+ | {{#set: common name=trans-retinol|retinol|vitamin A|vitamin A1}} | ||
+ | {{#set: consumed by=1.3.99.23-RXN|RXN-12547}} | ||
+ | {{#set: produced by=RXN-12575|3.1.1.64-RXN|RXN-12579}} | ||
+ | {{#set: reversible reaction associated=RETINOL-DEHYDROGENASE-RXN}} |
Latest revision as of 20:16, 21 March 2018
Contents
Metabolite CPD-13524
- smiles:
- CC(=CC=CC(C)=CCO)C=CC1(=C(C)CCCC(C)(C)1)
- common name:
- all-trans-retinol
- inchi key:
- InChIKey=FPIPGXGPPPQFEQ-OVSJKPMPSA-N
- molecular weight:
- 286.456
- Synonym(s):
- trans-retinol
- retinol
- vitamin A
- vitamin A1
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- LIPID_MAPS : LMPR01090001
- CAS : 68-26-8
- CAS : 11103-57-4
- Wikipedia : Retinol
- DRUGBANK : DB00162
- PUBCHEM:
- HMDB : HMDB00305
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC17336