Difference between revisions of "CPD-8058"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6780 PWY-6780] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8058 CPD-8058] == * smiles: ** COC1(C(C(C(C(C1O)O)O)O)OC2(C(C(C(C(O2)CO)O)O)O)) * common na...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8058 CPD-8058] == |
| − | * | + | * smiles: |
| − | ** | + | ** COC1(C(C(C(C(C1O)O)O)O)OC2(C(C(C(C(O2)CO)O)O)O)) |
* common name: | * common name: | ||
| − | ** | + | ** D-galactosylononitol |
| + | * inchi key: | ||
| + | ** InChIKey=RSYNCMYDVZFZBP-NRORZAABSA-N | ||
| + | * molecular weight: | ||
| + | ** 356.326 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** galactosyl sequoyitol | ||
| + | ** O-α-D-galactopyranosyl-(1,3)-4O-methyl-D-myo-inositol | ||
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-8281]] | |
| − | == Reaction(s) | + | == Reaction(s) of unknown directionality == |
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202605 25202605] |
| − | {{#set: | + | {{#set: smiles=COC1(C(C(C(C(C1O)O)O)O)OC2(C(C(C(C(O2)CO)O)O)O))}} |
| − | {{#set: | + | {{#set: common name=D-galactosylononitol}} |
| + | {{#set: inchi key=InChIKey=RSYNCMYDVZFZBP-NRORZAABSA-N}} | ||
| + | {{#set: molecular weight=356.326 }} | ||
| + | {{#set: common name=galactosyl sequoyitol|O-α-D-galactopyranosyl-(1,3)-4O-methyl-D-myo-inositol}} | ||
| + | {{#set: produced by=RXN-8281}} | ||
Latest revision as of 19:16, 21 March 2018
Contents
Metabolite CPD-8058
- smiles:
- COC1(C(C(C(C(C1O)O)O)O)OC2(C(C(C(C(O2)CO)O)O)O))
- common name:
- D-galactosylononitol
- inchi key:
- InChIKey=RSYNCMYDVZFZBP-NRORZAABSA-N
- molecular weight:
- 356.326
- Synonym(s):
- galactosyl sequoyitol
- O-α-D-galactopyranosyl-(1,3)-4O-methyl-D-myo-inositol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
