Difference between revisions of "CPD-8058"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8058 CPD-8058] == * smiles: ** COC1(C(C(C(C(C1O)O)O)O)OC2(C(C(C(C(O2)CO)O)O)O)) * common na...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Pathway]]
+
[[Category:Metabolite]]
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6780 PWY-6780] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8058 CPD-8058] ==
* taxonomic range:
+
* smiles:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
+
** COC1(C(C(C(C(C1O)O)O)O)OC2(C(C(C(C(O2)CO)O)O)O))
 
* common name:
 
* common name:
** hydrogen production VI
+
** D-galactosylononitol
 +
* inchi key:
 +
** InChIKey=RSYNCMYDVZFZBP-NRORZAABSA-N
 +
* molecular weight:
 +
** 356.326   
 
* Synonym(s):
 
* Synonym(s):
 +
** galactosyl sequoyitol
 +
** O-α-D-galactopyranosyl-(1,3)-4O-methyl-D-myo-inositol
  
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
'''1''' reactions found over '''2''' reactions in the full pathway
+
== Reaction(s) known to produce the compound ==
* [[HYDROG-RXN]]
+
* [[RXN-8281]]
== Reaction(s) not found ==
+
== Reaction(s) of unknown directionality ==
* [http://metacyc.org/META/NEW-IMAGE?object=1.2.7.4-RXN 1.2.7.4-RXN]
+
 
== External links  ==
 
== External links  ==
{{#set: taxonomic range=TAX-2}}
+
* PUBCHEM:
{{#set: common name=hydrogen production VI}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202605 25202605]
{{#set: reaction found=1}}
+
{{#set: smiles=COC1(C(C(C(C(C1O)O)O)O)OC2(C(C(C(C(O2)CO)O)O)O))}}
{{#set: reaction not found=2}}
+
{{#set: common name=D-galactosylononitol}}
{{#set: completion rate=50.0}}
+
{{#set: inchi key=InChIKey=RSYNCMYDVZFZBP-NRORZAABSA-N}}
 +
{{#set: molecular weight=356.326    }}
 +
{{#set: common name=galactosyl sequoyitol|O-α-D-galactopyranosyl-(1,3)-4O-methyl-D-myo-inositol}}
 +
{{#set: produced by=RXN-8281}}

Latest revision as of 20:16, 21 March 2018

Metabolite CPD-8058

  • smiles:
    • COC1(C(C(C(C(C1O)O)O)O)OC2(C(C(C(C(O2)CO)O)O)O))
  • common name:
    • D-galactosylononitol
  • inchi key:
    • InChIKey=RSYNCMYDVZFZBP-NRORZAABSA-N
  • molecular weight:
    • 356.326
  • Synonym(s):
    • galactosyl sequoyitol
    • O-α-D-galactopyranosyl-(1,3)-4O-methyl-D-myo-inositol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links