Difference between revisions of "CPD-714"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_11399 == * left end position: ** 441 * transcription direction: ** NEGATIVE * right end position: ** 3463 * centisome position: ** 5.645884...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-714 CPD-714] == * smiles: ** CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1...")
 
(4 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_11399 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-714 CPD-714] ==
* left end position:
+
* smiles:
** 441
+
** CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
* transcription direction:
+
* common name:
** NEGATIVE
+
** cathasterone
* right end position:
+
* inchi key:
** 3463
+
** InChIKey=JSVPGVHCEQDJCZ-VGEHDTSWSA-N
* centisome position:
+
* molecular weight:
** 5.645884    
+
** 432.685    
 
* Synonym(s):
 
* Synonym(s):
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[NAD+-ADP-RIBOSYLTRANSFERASE-RXN]]
+
* [[RXN-716]]
** in-silico_annotation
+
== Reaction(s) known to produce the compound ==
***ec-number
+
* [[RXN-715]]
== Pathways associated ==
+
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: left end position=441}}
+
* PUBCHEM:
{{#set: transcription direction=NEGATIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=15341086 15341086]
{{#set: right end position=3463}}
+
* CHEBI:
{{#set: centisome position=5.645884   }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=23057 23057]
{{#set: reaction associated=NAD+-ADP-RIBOSYLTRANSFERASE-RXN}}
+
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C15790 C15790]
 +
{{#set: smiles=CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
 +
{{#set: common name=cathasterone}}
 +
{{#set: inchi key=InChIKey=JSVPGVHCEQDJCZ-VGEHDTSWSA-N}}
 +
{{#set: molecular weight=432.685   }}
 +
{{#set: consumed by=RXN-716}}
 +
{{#set: produced by=RXN-715}}

Latest revision as of 19:16, 21 March 2018

Metabolite CPD-714

  • smiles:
    • CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
  • common name:
    • cathasterone
  • inchi key:
    • InChIKey=JSVPGVHCEQDJCZ-VGEHDTSWSA-N
  • molecular weight:
    • 432.685
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.