Difference between revisions of "CPD-714"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-714 CPD-714] == * smiles: ** CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1...") |
|||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-714 CPD-714] == |
+ | * smiles: | ||
+ | ** CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34)))) | ||
* common name: | * common name: | ||
− | ** | + | ** cathasterone |
+ | * inchi key: | ||
+ | ** InChIKey=JSVPGVHCEQDJCZ-VGEHDTSWSA-N | ||
+ | * molecular weight: | ||
+ | ** 432.685 | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-716]] | |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | == Reaction(s) | + | * [[RXN-715]] |
− | * [ | + | == Reaction(s) of unknown directionality == |
== External links == | == External links == | ||
− | * | + | * PUBCHEM: |
− | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=15341086 15341086] |
− | {{#set: | + | * CHEBI: |
− | {{#set: common name= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=23057 23057] |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C15790 C15790] |
− | {{#set: | + | {{#set: smiles=CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))}} |
+ | {{#set: common name=cathasterone}} | ||
+ | {{#set: inchi key=InChIKey=JSVPGVHCEQDJCZ-VGEHDTSWSA-N}} | ||
+ | {{#set: molecular weight=432.685 }} | ||
+ | {{#set: consumed by=RXN-716}} | ||
+ | {{#set: produced by=RXN-715}} |
Latest revision as of 19:16, 21 March 2018
Contents
Metabolite CPD-714
- smiles:
- CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
- common name:
- cathasterone
- inchi key:
- InChIKey=JSVPGVHCEQDJCZ-VGEHDTSWSA-N
- molecular weight:
- 432.685
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.