Difference between revisions of "PWY-7442"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11495 CPD-11495] == * smiles: ** C(=O)([O-])CC1(=CC=CC=C(O)1) * inchi key: ** InChIKey=CCVY...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7442 PWY-7442] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-7215 TAX-72...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7442 PWY-7442] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-7215 TAX-7215] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** drosopterin and aurodrosopterin biosynthesis |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | + | '''2''' reactions found over '''7''' reactions in the full pathway | |
| − | * [[RXN- | + | * [[GTP-CYCLOHYDRO-I-RXN]] |
| − | == Reaction(s) | + | ** 1 associated gene(s): |
| + | *** [[Tiso_gene_12736]] | ||
| + | ** 3 reconstruction source(s) associated: | ||
| + | *** [[orthology-creinhardtii]] | ||
| + | *** [[orthology-synechocystis]] | ||
| + | *** [[orthology-esiliculosus]] | ||
| + | * [[RXN-15261]] | ||
| + | ** 1 associated gene(s): | ||
| + | *** [[Tiso_gene_12280]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-in-silico_annotation]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=1.5.4.1-RXN 1.5.4.1-RXN] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=4.2.3.12-RXN 4.2.3.12-RXN] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-15260 RXN-15260] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-15262 RXN-15262] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-15263 RXN-15263] | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-7215}} | |
| − | + | {{#set: common name=drosopterin and aurodrosopterin biosynthesis}} | |
| − | + | {{#set: reaction found=2}} | |
| − | + | {{#set: total reaction=7}} | |
| − | + | {{#set: completion rate=29.0}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:16, 21 March 2018
Pathway PWY-7442
- taxonomic range:
- common name:
- drosopterin and aurodrosopterin biosynthesis
- Synonym(s):
Reaction(s) found
2 reactions found over 7 reactions in the full pathway
- GTP-CYCLOHYDRO-I-RXN
- 1 associated gene(s):
- 3 reconstruction source(s) associated:
- RXN-15261
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
