Difference between revisions of "CPD-11495"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5070 PWY-5070] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-3...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11495 CPD-11495] == * smiles: ** C(=O)([O-])CC1(=CC=CC=C(O)1) * common name: ** 2-hydroxyph...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Pathway]]
+
[[Category:Metabolite]]
−
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5070 PWY-5070] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11495 CPD-11495] ==
−
* taxonomic range:
+
* smiles:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
+
** C(=O)([O-])CC1(=CC=CC=C(O)1)
 
* common name:
 
* common name:
−
** gibberellin biosynthesis I (non C-3, non C-13 hydroxylation)
+
** 2-hydroxyphenylacetate
 +
* inchi key:
 +
** InChIKey=CCVYRRGZDBSHFU-UHFFFAOYSA-M
 +
* molecular weight:
 +
** 151.141   
 
* Synonym(s):
 
* Synonym(s):
−
** gibberellin biosynthesis I (late C-3 hydroxylation)
+
** 2-hydroxyphenylacetic acid
−
** gibberellin biosynthesis I (late C-13 hydroxylation)
+
** benzeneacetic acid, 2-hydroxy-
 +
** 2-hydroxybenzeneacetic acid
 +
** acetic acid, (o-hydroxyphenyl)-
 +
** o-hydroxy phenylacetic acid
 +
** o-hydroxyphenylacetate
 +
** o-hydroxyphenylacetic acid
  
−
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
−
'''3''' reactions found over '''7''' reactions in the full pathway
+
== Reaction(s) known to produce the compound ==
−
* [[RXN1F-162]]
+
* [[RXN-10815]]
−
** 1 associated gene(s):
+
== Reaction(s) of unknown directionality ==
−
*** [[Tiso_gene_3330]]
+
−
** 2 reconstruction source(s) associated:
+
−
*** [[orthology-athaliana]]
+
−
*** [[orthology-esiliculosus]]
+
−
* [[RXN1F-163]]
+
−
** 1 associated gene(s):
+
−
*** [[Tiso_gene_3330]]
+
−
** 2 reconstruction source(s) associated:
+
−
*** [[orthology-athaliana]]
+
−
*** [[orthology-esiliculosus]]
+
−
* [[RXN1F-165]]
+
−
** 1 associated gene(s):
+
−
*** [[Tiso_gene_3330]]
+
−
** 2 reconstruction source(s) associated:
+
−
*** [[orthology-athaliana]]
+
−
*** [[orthology-esiliculosus]]
+
−
== Reaction(s) not found ==
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-6523 RXN-6523]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-6541 RXN-6541]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN1F-164 RXN1F-164]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN1F-99 RXN1F-99]
+
 
== External links  ==
 
== External links  ==
−
* ARACYC:
+
* PUBCHEM:
−
** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-5070 PWY-5070]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6933325 6933325]
−
{{#set: taxonomic range=TAX-33090}}
+
* CHEMSPIDER:
−
{{#set: common name=gibberellin biosynthesis I (non C-3, non C-13 hydroxylation)}}
+
** [http://www.chemspider.com/Chemical-Structure.5307390.html 5307390]
−
{{#set: common name=gibberellin biosynthesis I (late C-3 hydroxylation)|gibberellin biosynthesis I (late C-13 hydroxylation)}}
+
* HMDB : HMDB00669
−
{{#set: reaction found=3}}
+
* CHEBI:
−
{{#set: total reaction=7}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62423 62423]
−
{{#set: completion rate=43.0}}
+
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C05852 C05852]
 +
{{#set: smiles=C(=O)([O-])CC1(=CC=CC=C(O)1)}}
 +
{{#set: common name=2-hydroxyphenylacetate}}
 +
{{#set: inchi key=InChIKey=CCVYRRGZDBSHFU-UHFFFAOYSA-M}}
 +
{{#set: molecular weight=151.141    }}
 +
{{#set: common name=2-hydroxyphenylacetic acid|benzeneacetic acid, 2-hydroxy-|2-hydroxybenzeneacetic acid|acetic acid, (o-hydroxyphenyl)-|o-hydroxy phenylacetic acid|o-hydroxyphenylacetate|o-hydroxyphenylacetic acid}}
 +
{{#set: produced by=RXN-10815}}

Latest revision as of 19:16, 21 March 2018

Metabolite CPD-11495

  • smiles:
    • C(=O)([O-])CC1(=CC=CC=C(O)1)
  • common name:
    • 2-hydroxyphenylacetate
  • inchi key:
    • InChIKey=CCVYRRGZDBSHFU-UHFFFAOYSA-M
  • molecular weight:
    • 151.141
  • Synonym(s):
    • 2-hydroxyphenylacetic acid
    • benzeneacetic acid, 2-hydroxy-
    • 2-hydroxybenzeneacetic acid
    • acetic acid, (o-hydroxyphenyl)-
    • o-hydroxy phenylacetic acid
    • o-hydroxyphenylacetate
    • o-hydroxyphenylacetic acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(=O)([O-])CC1(=CC=CC=C(O)1)" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-11495&oldid=40563"