Difference between revisions of "Tiso gene 5008"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14601 CPD-14601] == * smiles: ** CC(CCC([O-])=O)=CCC1(=C(C(C)=C2(COC(=O)C(=C(O)1)2))OC) * c...")
(Created page with "Category:Gene == Gene Tiso_gene_5008 == * right end position: ** 8090 * transcription direction: ** POSITIVE * left end position: ** 4987 * centisome position: ** 35.51994...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14601 CPD-14601] ==
+
== Gene Tiso_gene_5008 ==
−
* smiles:
+
* right end position:
−
** CC(CCC([O-])=O)=CCC1(=C(C(C)=C2(COC(=O)C(=C(O)1)2))OC)
+
** 8090
−
* common name:
+
* transcription direction:
−
** mycophenolate
+
** POSITIVE
−
* inchi key:
+
* left end position:
−
** InChIKey=HPNSFSBZBAHARI-RUDMXATFSA-M
+
** 4987
−
* molecular weight:
+
* centisome position:
−
** 319.333    
+
** 35.519943    
 
* Synonym(s):
 
* Synonym(s):
−
** mycophenolic acid
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-13608]]
+
* Reaction: [[1TRANSKETO-RXN]]
−
* [[RXN-13607]]
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) known to produce the compound ==
+
*** Assignment: ec-number
−
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-synechocystis]]
 +
* Reaction: [[2TRANSKETO-RXN]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Reaction: [[R01067]]
 +
** Source: [[orthology-synechocystis]]
 +
== Pathways associated ==
 +
* [[PWY-6901]]
 +
* [[P124-PWY]]
 +
* [[CALVIN-PWY]]
 +
* [[P21-PWY]]
 +
* [[PWY-5723]]
 +
* [[PWY-1861]]
 +
* [[P185-PWY]]
 +
* [[NONOXIPENT-PWY]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=8090}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6918995 6918995]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: left end position=4987}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62932 62932]
+
{{#set: centisome position=35.519943   }}
−
{{#set: smiles=CC(CCC([O-])=O)=CCC1(=C(C(C)=C2(COC(=O)C(=C(O)1)2))OC)}}
+
{{#set: reaction associated=1TRANSKETO-RXN|2TRANSKETO-RXN|R01067}}
−
{{#set: common name=mycophenolate}}
+
{{#set: pathway associated=PWY-6901|P124-PWY|CALVIN-PWY|P21-PWY|PWY-5723|PWY-1861|P185-PWY|NONOXIPENT-PWY}}
−
{{#set: inchi key=InChIKey=HPNSFSBZBAHARI-RUDMXATFSA-M}}
+
−
{{#set: molecular weight=319.333   }}
+
−
{{#set: common name=mycophenolic acid}}
+
−
{{#set: consumed by=RXN-13608|RXN-13607}}
+

Latest revision as of 19:16, 21 March 2018

Gene Tiso_gene_5008

  • right end position:
    • 8090
  • transcription direction:
    • POSITIVE
  • left end position:
    • 4987
  • centisome position:
    • 35.519943
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_5008&oldid=40584"