Difference between revisions of "Tiso gene 18843"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7014 CPD-7014] == * smiles: ** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC...")
(Created page with "Category:Gene == Gene Tiso_gene_18843 == * right end position: ** 1237 * transcription direction: ** POSITIVE * left end position: ** 7 * centisome position: ** 0.25343955...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7014 CPD-7014] ==
+
== Gene Tiso_gene_18843 ==
* smiles:
+
* right end position:
** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(C=O)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
+
** 1237
* common name:
+
* transcription direction:
** chlorophyllide b
+
** POSITIVE
* molecular weight:
+
* left end position:
** 626.95    
+
** 7
 +
* centisome position:
 +
** 0.25343955    
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN-7674]]
+
* Reaction: [[2.4.2.31-RXN]]
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
* [[RXN-7677]]
+
*** Assignment: ec-number
* [[RXN-13398]]
+
== Pathways associated ==
== Reaction(s) of unknown directionality ==
+
* [[RXN-7673]]
+
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: right end position=1237}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658741 90658741]
+
{{#set: transcription direction=POSITIVE}}
* CHEBI:
+
{{#set: left end position=7}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58686 58686]
+
{{#set: centisome position=0.25343955    }}
* LIGAND-CPD:
+
{{#set: reaction associated=2.4.2.31-RXN}}
** [http://www.genome.jp/dbget-bin/www_bget?C16541 C16541]
+
{{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(C=O)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))}}
+
{{#set: common name=chlorophyllide b}}
+
{{#set: molecular weight=626.95    }}
+
{{#set: consumed by=RXN-7674}}
+
{{#set: produced by=RXN-7677|RXN-13398}}
+
{{#set: reversible reaction associated=RXN-7673}}
+

Latest revision as of 20:16, 21 March 2018

Gene Tiso_gene_18843

  • right end position:
    • 1237
  • transcription direction:
    • POSITIVE
  • left end position:
    • 7
  • centisome position:
    • 0.25343955
  • Synonym(s):

Reactions associated

Pathways associated

External links