Difference between revisions of "PWY4FS-8"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP-SULFOQUINOVOSE UDP-SULFOQUINOVOSE] == * smiles: ** C(OP(=O)([O-])OP(=O)(OC1(OC(CS(=O)(=O)[O...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY4FS-8 PWY4FS-8] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-27...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP-SULFOQUINOVOSE UDP-SULFOQUINOVOSE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY4FS-8 PWY4FS-8] ==
* smiles:
+
* taxonomic range:
** C(OP(=O)([O-])OP(=O)(OC1(OC(CS(=O)(=O)[O-])C(O)C(O)C(O)1))[O-])C2(C(O)C(O)C(O2)N3(C=CC(=O)NC(=O)3))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
** InChIKey=FQANCGQCBCUSMI-JZMIEXBBSA-K
+
 
* common name:
 
* common name:
** UDP-α-D-sulfoquinovopyranose
+
** phosphatidylglycerol biosynthesis II (non-plastidic)
* molecular weight:
+
** 627.34   
+
 
* Synonym(s):
 
* Synonym(s):
** UDP-6-sulfoquinovose
 
** UDP-sulfoquinovose
 
** UDP-α-D-sulfoquinovose
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-1224]]
+
'''3''' reactions found over '''4''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[PGPPHOSPHA-RXN]]
* [[RXN-1223]]
+
** 1 associated gene(s):
== Reaction(s) of unknown directionality ==
+
*** [[Tiso_gene_18092]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[annotation-experimental_annotation]]
 +
* [[PHOSPHAGLYPSYN-RXN]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
* [[PWY-5667]]
 +
** 0 associated gene:
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: taxonomic range=TAX-2759}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200933 25200933]
+
{{#set: taxonomic range=TAX-2}}
* CHEBI:
+
{{#set: common name=phosphatidylglycerol biosynthesis II (non-plastidic)}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60009 60009]
+
{{#set: reaction found=3}}
* LIGAND-CPD:
+
{{#set: total reaction=4}}
** [http://www.genome.jp/dbget-bin/www_bget?C11521 C11521]
+
{{#set: completion rate=75.0}}
{{#set: smiles=C(OP(=O)([O-])OP(=O)(OC1(OC(CS(=O)(=O)[O-])C(O)C(O)C(O)1))[O-])C2(C(O)C(O)C(O2)N3(C=CC(=O)NC(=O)3))}}
+
{{#set: inchi key=InChIKey=FQANCGQCBCUSMI-JZMIEXBBSA-K}}
+
{{#set: common name=UDP-α-D-sulfoquinovopyranose}}
+
{{#set: molecular weight=627.34    }}
+
{{#set: common name=UDP-6-sulfoquinovose|UDP-sulfoquinovose|UDP-α-D-sulfoquinovose}}
+
{{#set: consumed by=RXN-1224}}
+
{{#set: produced by=RXN-1223}}
+

Latest revision as of 19:17, 21 March 2018

Pathway PWY4FS-8

  • taxonomic range:
  • common name:
    • phosphatidylglycerol biosynthesis II (non-plastidic)
  • Synonym(s):

Reaction(s) found

3 reactions found over 4 reactions in the full pathway

Reaction(s) not found

External links