Difference between revisions of "H2Otm"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-133 CPD1F-133] == * smiles: ** CC(=CC=CC=C(C=CC=C(C)C=CC12(C(C)(C)CC(O)CC(O1)(C)2))C)C=CC...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=H2Otm H2Otm] == * direction: ** REVERSIBLE * common name: ** H2O transport, mitochondrial * Synonym...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-133 CPD1F-133] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=H2Otm H2Otm] ==
−
* smiles:
+
* direction:
−
** CC(=CC=CC=C(C=CC=C(C)C=CC12(C(C)(C)CC(O)CC(O1)(C)2))C)C=CC=C(C)C=CC34(C(C)(C)CC(O)CC(O3)(C)4)
+
** REVERSIBLE
−
* inchi key:
+
−
** InChIKey=SZCBXWMUOPQSOX-WVJDLNGLSA-N
+
 
* common name:
 
* common name:
−
** violaxanthin
+
** H2O transport, mitochondrial
−
* molecular weight:
+
−
** 600.88   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 5,6,5',6'-diepoxy-5,6,5',6'-tetrahydro-β,β-carotene-3,3'-diol
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-7984]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1.0 [[WATER]][c] '''<=>''' 1.0 [[WATER]][m]
−
* [[RXN-7979]]
+
* With common name(s):
−
* [[RXN-13193]]
+
** 1.0 H2O[c] '''<=>''' 1.0 H2O[m]
−
* [[ANXANor]]
+
 
−
== Reaction(s) of unknown directionality ==
+
== Genes associated with this reaction  ==
−
* [[RXN-13185]]
+
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_11818]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=REVERSIBLE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=448438 448438]
+
{{#set: common name=H2O transport, mitochondrial}}
−
* CHEBI:
+
{{#set: gene associated=Tiso_gene_11818}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=35288 35288]
+
{{#set: in pathway=}}
−
* LIGAND-CPD:
+
{{#set: reconstruction category=orthology}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C08614 C08614]
+
{{#set: reconstruction source=orthology-creinhardtii}}
−
* HMDB : HMDB03101
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: smiles=CC(=CC=CC=C(C=CC=C(C)C=CC12(C(C)(C)CC(O)CC(O1)(C)2))C)C=CC=C(C)C=CC34(C(C)(C)CC(O)CC(O3)(C)4)}}
+
−
{{#set: inchi key=InChIKey=SZCBXWMUOPQSOX-WVJDLNGLSA-N}}
+
−
{{#set: common name=violaxanthin}}
+
−
{{#set: molecular weight=600.88    }}
+
−
{{#set: common name=5,6,5',6'-diepoxy-5,6,5',6'-tetrahydro-&beta;,&beta;-carotene-3,3'-diol}}
+
−
{{#set: consumed by=RXN-7984}}
+
−
{{#set: produced by=RXN-7979|RXN-13193|ANXANor}}
+
−
{{#set: consumed or produced by=RXN-13185}}
+

Latest revision as of 20:18, 21 March 2018

Reaction H2Otm

  • direction:
    • REVERSIBLE
  • common name:
    • H2O transport, mitochondrial
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 H2O[c] <=> 1.0 H2O[m]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=H2Otm&oldid=40734"