Difference between revisions of "O-SUCCINYL-L-HOMOSERINE"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_14609 == * left end position: ** 1323 * transcription direction: ** NEGATIVE * right end position: ** 2836 * centisome position: ** 23.8851...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=O-SUCCINYL-L-HOMOSERINE O-SUCCINYL-L-HOMOSERINE] == * smiles: ** C(CC(=O)OCCC(C([O-])=O)[N+])C(...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=O-SUCCINYL-L-HOMOSERINE O-SUCCINYL-L-HOMOSERINE] == |
− | * | + | * smiles: |
− | ** | + | ** C(CC(=O)OCCC(C([O-])=O)[N+])C([O-])=O |
− | * | + | * common name: |
− | ** | + | ** O-succinyl-L-homoserine |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=GNISQJGXJIDKDJ-YFKPBYRVSA-M |
− | * | + | * molecular weight: |
− | ** | + | ** 218.186 |
* Synonym(s): | * Synonym(s): | ||
+ | ** O-succinyl-homoserine | ||
+ | ** succinyl-homoserine | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[SUCHMSSELCYSLh]] |
− | + | * [[METBALT-RXN]] | |
− | + | * [[SUCHMSSELCYSL]] | |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | * | + | == Reaction(s) of unknown directionality == |
− | + | * [[O-SUCCHOMOSERLYASE-RXN]] | |
− | * [[ | + | * [[RXN-9384]] |
− | * | + | |
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * CAS : 1492-23-5 |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878420 46878420] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57661 57661] |
+ | * BIGG : suchms | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C01118 C01118] | ||
+ | {{#set: smiles=C(CC(=O)OCCC(C([O-])=O)[N+])C([O-])=O}} | ||
+ | {{#set: common name=O-succinyl-L-homoserine}} | ||
+ | {{#set: inchi key=InChIKey=GNISQJGXJIDKDJ-YFKPBYRVSA-M}} | ||
+ | {{#set: molecular weight=218.186 }} | ||
+ | {{#set: common name=O-succinyl-homoserine|succinyl-homoserine}} | ||
+ | {{#set: consumed by=SUCHMSSELCYSLh|METBALT-RXN|SUCHMSSELCYSL}} | ||
+ | {{#set: reversible reaction associated=O-SUCCHOMOSERLYASE-RXN|RXN-9384}} |
Latest revision as of 19:18, 21 March 2018
Contents
Metabolite O-SUCCINYL-L-HOMOSERINE
- smiles:
- C(CC(=O)OCCC(C([O-])=O)[N+])C([O-])=O
- common name:
- O-succinyl-L-homoserine
- inchi key:
- InChIKey=GNISQJGXJIDKDJ-YFKPBYRVSA-M
- molecular weight:
- 218.186
- Synonym(s):
- O-succinyl-homoserine
- succinyl-homoserine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(CC(=O)OCCC(C([O-])=O)[N+])C([O-])=O" cannot be used as a page name in this wiki.