Difference between revisions of "UDP-SULFOQUINOVOSE"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_20058 == * Synonym(s): == Reactions associated == * DIACYLGLYCEROL-O-ACYLTRANSFERASE-RXN ** pantograph-esiliculosus * RXN-12...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP-SULFOQUINOVOSE UDP-SULFOQUINOVOSE] == * smiles: ** C(OP(=O)([O-])OP(=O)(OC1(OC(CS(=O)(=O)[O...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP-SULFOQUINOVOSE UDP-SULFOQUINOVOSE] == |
| + | * smiles: | ||
| + | ** C(OP(=O)([O-])OP(=O)(OC1(OC(CS(=O)(=O)[O-])C(O)C(O)C(O)1))[O-])C2(C(O)C(O)C(O2)N3(C=CC(=O)NC(=O)3)) | ||
| + | * common name: | ||
| + | ** UDP-α-D-sulfoquinovopyranose | ||
| + | * inchi key: | ||
| + | ** InChIKey=FQANCGQCBCUSMI-JZMIEXBBSA-K | ||
| + | * molecular weight: | ||
| + | ** 627.34 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** UDP-6-sulfoquinovose | ||
| + | ** UDP-sulfoquinovose | ||
| + | ** UDP-α-D-sulfoquinovose | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-1224]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | * [[RXN- | + | * [[RXN-1223]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | == | + | |
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200933 25200933] |
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60009 60009] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C11521 C11521] | ||
| + | {{#set: smiles=C(OP(=O)([O-])OP(=O)(OC1(OC(CS(=O)(=O)[O-])C(O)C(O)C(O)1))[O-])C2(C(O)C(O)C(O2)N3(C=CC(=O)NC(=O)3))}} | ||
| + | {{#set: common name=UDP-α-D-sulfoquinovopyranose}} | ||
| + | {{#set: inchi key=InChIKey=FQANCGQCBCUSMI-JZMIEXBBSA-K}} | ||
| + | {{#set: molecular weight=627.34 }} | ||
| + | {{#set: common name=UDP-6-sulfoquinovose|UDP-sulfoquinovose|UDP-α-D-sulfoquinovose}} | ||
| + | {{#set: consumed by=RXN-1224}} | ||
| + | {{#set: produced by=RXN-1223}} | ||
Latest revision as of 19:18, 21 March 2018
Contents
Metabolite UDP-SULFOQUINOVOSE
- smiles:
- C(OP(=O)([O-])OP(=O)(OC1(OC(CS(=O)(=O)[O-])C(O)C(O)C(O)1))[O-])C2(C(O)C(O)C(O2)N3(C=CC(=O)NC(=O)3))
- common name:
- UDP-α-D-sulfoquinovopyranose
- inchi key:
- InChIKey=FQANCGQCBCUSMI-JZMIEXBBSA-K
- molecular weight:
- 627.34
- Synonym(s):
- UDP-6-sulfoquinovose
- UDP-sulfoquinovose
- UDP-α-D-sulfoquinovose
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(OP(=O)([O-])OP(=O)(OC1(OC(CS(=O)(=O)[O-])C(O)C(O)C(O)1))[O-])C2(C(O)C(O)C(O2)N3(C=CC(=O)NC(=O)3))" cannot be used as a page name in this wiki.
