Difference between revisions of "Glucopyranose"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MONO-VINYL-PROTOCHLOROPHYLLIDE-A MONO-VINYL-PROTOCHLOROPHYLLIDE-A] == * smiles: ** C=CC2(C(C)=C...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Glucopyranose Glucopyranose] == * common name: ** D-glucopyranose * Synonym(s): ** 6-(hydroxyme...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MONO-VINYL-PROTOCHLOROPHYLLIDE-A MONO-VINYL-PROTOCHLOROPHYLLIDE-A] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Glucopyranose Glucopyranose] ==
−
* smiles:
+
−
** C=CC2(C(C)=C4(C=C9(C(C)=C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
+
 
* common name:
 
* common name:
−
** protochlorophyllide a
+
** D-glucopyranose
−
* molecular weight:
+
−
** 610.951   
+
 
* Synonym(s):
 
* Synonym(s):
−
** monovinyl protochlorophyllide a
+
** 6-(hydroxymethyl)tetrahydropyran-2,3,4,5-tetraol
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[R03845]]
+
* [[LACTOSE-SYNTHASE-RXN]]
 +
* [[GLUCOKIN-RXN]]
 +
* [[RXN66-521]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-14408]]
 +
* [[RXN-14179]]
 +
* [[3.2.1.106-RXN]]
 +
* [[3.2.1.84-RXN]]
 +
* [[RXN-14281]]
 +
* [[RXN-14283]]
 +
* [[RXN-14282]]
 +
* [[RXN-15910]]
 +
* [[GLUCOSYLCERAMIDASE-RXN]]
 +
* [[2.3.1.91-RXN]]
 +
* [[RXN0-5183]]
 +
* [[MALTODEXGLUCOSID-RXN]]
 +
* [[3.2.1.48-RXN]]
 +
* [[RXN-10773]]
 +
* [[BETAGALACTOSID-RXN]]
 +
* [[3.2.1.21-RXN]]
 +
* [[3.2.1.39-RXN]]
 +
* [[RXN-9674]]
 +
* [[RXN-5341]]
 +
* [[RXN-8036]]
 +
* [[KETOLACTOSE-RXN]]
 +
* [[ALPHAGALACTOSID-RXN]]
 +
* [[RXN-13600]]
 +
* [[RXN-13602]]
 +
* [[RXN-13603]]
 +
* [[RXN-10769]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
* [[RXN1F-10]]
+
* [[RXN-11334]]
 
== External links  ==
 
== External links  ==
−
* CAS : 14751-08-7
+
{{#set: common name=D-glucopyranose}}
−
* PUBCHEM:
+
{{#set: common name=6-(hydroxymethyl)tetrahydropyran-2,3,4,5-tetraol}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54749448 54749448]
+
{{#set: consumed by=LACTOSE-SYNTHASE-RXN|GLUCOKIN-RXN|RXN66-521}}
−
* CHEBI:
+
{{#set: produced by=RXN-14408|RXN-14179|3.2.1.106-RXN|3.2.1.84-RXN|RXN-14281|RXN-14283|RXN-14282|RXN-15910|GLUCOSYLCERAMIDASE-RXN|2.3.1.91-RXN|RXN0-5183|MALTODEXGLUCOSID-RXN|3.2.1.48-RXN|RXN-10773|BETAGALACTOSID-RXN|3.2.1.21-RXN|3.2.1.39-RXN|RXN-9674|RXN-5341|RXN-8036|KETOLACTOSE-RXN|ALPHAGALACTOSID-RXN|RXN-13600|RXN-13602|RXN-13603|RXN-10769}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57855 57855]
+
{{#set: reversible reaction associated=RXN-11334}}
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C02880 C02880]
+
−
* HMDB : HMDB31148
+
−
{{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)=C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))}}
+
−
{{#set: common name=protochlorophyllide a}}
+
−
{{#set: molecular weight=610.951    }}
+
−
{{#set: common name=monovinyl protochlorophyllide a}}
+
−
{{#set: consumed by=R03845}}
+
−
{{#set: consumed or produced by=RXN1F-10}}
+

Latest revision as of 19:18, 21 March 2018

Metabolite Glucopyranose

  • common name:
    • D-glucopyranose
  • Synonym(s):
    • 6-(hydroxymethyl)tetrahydropyran-2,3,4,5-tetraol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Glucopyranose&oldid=40750"