Difference between revisions of "Tiso gene 14435"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14115 CPD-14115] == * smiles: ** C3(C(C1(CC2(=CC=C(C=C(OC1)2)O)))=CC=C(C=3)O) * inchi key:...") |
(Created page with "Category:Gene == Gene Tiso_gene_14435 == * right end position: ** 4621 * transcription direction: ** POSITIVE * left end position: ** 3530 * centisome position: ** 44.8823...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_14435 == |
− | * | + | * right end position: |
− | ** | + | ** 4621 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 3530 |
− | * | + | * centisome position: |
− | ** | + | ** 44.88239 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[5-NUCLEOTID-RXN]] | |
− | == | + | ** Source: [[annotation-in-silico_annotation]] |
− | * [[ | + | *** Assignment: ec-number |
+ | * Reaction: [[AMP-DEPHOSPHORYLATION-RXN]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN-14025]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN-14026]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN-14227]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN-5841]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN-7607]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN-7609]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[XMPXAN-RXN]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | == Pathways associated == | ||
+ | * [[PWY-5381]] | ||
+ | * [[PWY-6607]] | ||
+ | * [[PWY-7185]] | ||
+ | * [[PWY-7821]] | ||
+ | * [[SALVADEHYPOX-PWY]] | ||
+ | * [[PWY-6596]] | ||
+ | * [[NAD-BIOSYNTHESIS-II]] | ||
+ | * [[PWY-6606]] | ||
+ | * [[PWY-6608]] | ||
+ | * [[PWY-5695]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=4621}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=3530}} | |
− | + | {{#set: centisome position=44.88239 }} | |
− | + | {{#set: reaction associated=5-NUCLEOTID-RXN|AMP-DEPHOSPHORYLATION-RXN|RXN-14025|RXN-14026|RXN-14227|RXN-5841|RXN-7607|RXN-7609|XMPXAN-RXN}} | |
− | + | {{#set: pathway associated=PWY-5381|PWY-6607|PWY-7185|PWY-7821|SALVADEHYPOX-PWY|PWY-6596|NAD-BIOSYNTHESIS-II|PWY-6606|PWY-6608|PWY-5695}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:18, 21 March 2018
Gene Tiso_gene_14435
- right end position:
- 4621
- transcription direction:
- POSITIVE
- left end position:
- 3530
- centisome position:
- 44.88239
- Synonym(s):
Reactions associated
- Reaction: 5-NUCLEOTID-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: AMP-DEPHOSPHORYLATION-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: RXN-14025
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: RXN-14026
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: RXN-14227
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: RXN-5841
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: RXN-7607
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: RXN-7609
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: XMPXAN-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
Pathways associated
- PWY-5381
- PWY-6607
- PWY-7185
- PWY-7821
- SALVADEHYPOX-PWY
- PWY-6596
- NAD-BIOSYNTHESIS-II
- PWY-6606
- PWY-6608
- PWY-5695