Difference between revisions of "Tiso gene 14940"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18550 CPD-18550] == * smiles: ** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OC(=O)C4(...")
(Created page with "Category:Gene == Gene Tiso_gene_14940 == * Synonym(s): == Reactions associated == * Reaction: 2.7.10.1-RXN ** Source: orthology-esiliculosus * Reaction: 3.6.4.4...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18550 CPD-18550] ==
+
== Gene Tiso_gene_14940 ==
* smiles:
+
** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OC(=O)C4(C=NC5(=CC=CC=C(N=4)5)))([O-])=O
+
* inchi key:
+
** InChIKey=VMJWEICPCDRXQL-SCFUHWHPSA-M
+
* common name:
+
** quinoxaline-2-carboxyl adenylate
+
* molecular weight:
+
** 502.359   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN-17155]]
+
* Reaction: [[2.7.10.1-RXN]]
== Reaction(s) known to produce the compound ==
+
** Source: [[orthology-esiliculosus]]
== Reaction(s) of unknown directionality ==
+
* Reaction: [[3.6.4.4-RXN]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[PROTEIN-KINASE-RXN]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: reaction associated=2.7.10.1-RXN|3.6.4.4-RXN|PROTEIN-KINASE-RXN}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=102515331 102515331]
+
{{#set: smiles=C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OC(=O)C4(C=NC5(=CC=CC=C(N=4)5)))([O-])=O}}
+
{{#set: inchi key=InChIKey=VMJWEICPCDRXQL-SCFUHWHPSA-M}}
+
{{#set: common name=quinoxaline-2-carboxyl adenylate}}
+
{{#set: molecular weight=502.359    }}
+
{{#set: consumed by=RXN-17155}}
+

Latest revision as of 19:18, 21 March 2018

Gene Tiso_gene_14940

  • Synonym(s):

Reactions associated

Pathways associated

External links