Difference between revisions of "PWY-6333"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5721 CPD-5721] == * smiles: ** C1(N=C2(N=C(N)N=C([S-])C(N=1)2)) * inchi key: ** InChIKey=UH...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6333 PWY-6333] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-3...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6333 PWY-6333] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** acetaldehyde biosynthesis I |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** anoxic acetaldehyde biosynthesis |
| − | ** | + | ** flooding related acetaldehyde biosynthesis |
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | + | '''1''' reactions found over '''1''' reactions in the full pathway | |
| − | + | * [[ALCOHOL-DEHYDROG-RXN]] | |
| − | * [[ | + | ** 6 associated gene(s): |
| + | *** [[Tiso_gene_18459]] | ||
| + | *** [[Tiso_gene_7649]] | ||
| + | *** [[Tiso_gene_6563]] | ||
| + | *** [[Tiso_gene_5424]] | ||
| + | *** [[Tiso_gene_5425]] | ||
| + | *** [[Tiso_gene_6562]] | ||
| + | ** 2 reconstruction source(s) associated: | ||
| + | *** [[annotation-in-silico_annotation]] | ||
| + | *** [[orthology-synechocystis]] | ||
| + | == Reaction(s) not found == | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-33090}} | |
| − | + | {{#set: common name=acetaldehyde biosynthesis I}} | |
| − | + | {{#set: common name=anoxic acetaldehyde biosynthesis|flooding related acetaldehyde biosynthesis}} | |
| − | + | {{#set: reaction found=1}} | |
| − | + | {{#set: total reaction=1}} | |
| − | + | {{#set: completion rate=100.0}} | |
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:18, 21 March 2018
Pathway PWY-6333
- taxonomic range:
- common name:
- acetaldehyde biosynthesis I
- Synonym(s):
- anoxic acetaldehyde biosynthesis
- flooding related acetaldehyde biosynthesis
Reaction(s) found
1 reactions found over 1 reactions in the full pathway
- ALCOHOL-DEHYDROG-RXN
- 6 associated gene(s):
- 2 reconstruction source(s) associated:
