Difference between revisions of "CPD1F-133"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_15880 == * left end position: ** 107 * transcription direction: ** POSITIVE * right end position: ** 2220 * centisome position: ** 2.258813...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-133 CPD1F-133] == * smiles: ** CC(=CC=CC=C(C=CC=C(C)C=CC12(C(C)(C)CC(O)CC(O1)(C)2))C)C=CC...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Tiso_gene_15880 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-133 CPD1F-133] ==
−
* left end position:
+
* smiles:
−
** 107
+
** CC(=CC=CC=C(C=CC=C(C)C=CC12(C(C)(C)CC(O)CC(O1)(C)2))C)C=CC=C(C)C=CC34(C(C)(C)CC(O)CC(O3)(C)4)
−
* transcription direction:
+
* common name:
−
** POSITIVE
+
** violaxanthin
−
* right end position:
+
* inchi key:
−
** 2220
+
** InChIKey=SZCBXWMUOPQSOX-WVJDLNGLSA-N
−
* centisome position:
+
* molecular weight:
−
** 2.2588136    
+
** 600.88    
 
* Synonym(s):
 
* Synonym(s):
 +
** 5,6,5',6'-diepoxy-5,6,5',6'-tetrahydro-β,β-carotene-3,3'-diol
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[RXN-9988]]
+
* [[RXN-7984]]
−
** in-silico_annotation
+
== Reaction(s) known to produce the compound ==
−
***automated-name-match
+
* [[RXN-7979]]
−
== Pathways associated ==
+
* [[RXN-13193]]
−
* [[PWY-6138]]
+
* [[ANXANor]]
 +
== Reaction(s) of unknown directionality ==
 +
* [[RXN-13185]]
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=107}}
+
* PUBCHEM:
−
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=448438 448438]
−
{{#set: right end position=2220}}
+
* HMDB : HMDB03101
−
{{#set: centisome position=2.2588136   }}
+
* CHEBI:
−
{{#set: reaction associated=RXN-9988}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=35288 35288]
−
{{#set: pathway associated=PWY-6138}}
+
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C08614 C08614]
 +
{{#set: smiles=CC(=CC=CC=C(C=CC=C(C)C=CC12(C(C)(C)CC(O)CC(O1)(C)2))C)C=CC=C(C)C=CC34(C(C)(C)CC(O)CC(O3)(C)4)}}
 +
{{#set: common name=violaxanthin}}
 +
{{#set: inchi key=InChIKey=SZCBXWMUOPQSOX-WVJDLNGLSA-N}}
 +
{{#set: molecular weight=600.88   }}
 +
{{#set: common name=5,6,5',6'-diepoxy-5,6,5',6'-tetrahydro-β,β-carotene-3,3'-diol}}
 +
{{#set: consumed by=RXN-7984}}
 +
{{#set: produced by=RXN-7979|RXN-13193|ANXANor}}
 +
{{#set: reversible reaction associated=RXN-13185}}

Latest revision as of 19:18, 21 March 2018

Metabolite CPD1F-133

  • smiles:
    • CC(=CC=CC=C(C=CC=C(C)C=CC12(C(C)(C)CC(O)CC(O1)(C)2))C)C=CC=C(C)C=CC34(C(C)(C)CC(O)CC(O3)(C)4)
  • common name:
    • violaxanthin
  • inchi key:
    • InChIKey=SZCBXWMUOPQSOX-WVJDLNGLSA-N
  • molecular weight:
    • 600.88
  • Synonym(s):
    • 5,6,5',6'-diepoxy-5,6,5',6'-tetrahydro-β,β-carotene-3,3'-diol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links





Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD1F-133&oldid=40789"