Difference between revisions of "CPD1F-133"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16025 RXN-16025] == * direction: ** LEFT-TO-RIGHT * common name: ** 1-acylglycerol-3-phosphate_...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-133 CPD1F-133] == * smiles: ** CC(=CC=CC=C(C=CC=C(C)C=CC12(C(C)(C)CC(O)CC(O1)(C)2))C)C=CC...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-133 CPD1F-133] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC(=CC=CC=C(C=CC=C(C)C=CC12(C(C)(C)CC(O)CC(O1)(C)2))C)C=CC=C(C)C=CC34(C(C)(C)CC(O)CC(O3)(C)4) |
* common name: | * common name: | ||
| − | ** | + | ** violaxanthin |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=SZCBXWMUOPQSOX-WVJDLNGLSA-N |
| + | * molecular weight: | ||
| + | ** 600.88 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** 5,6,5',6'-diepoxy-5,6,5',6'-tetrahydro-β,β-carotene-3,3'-diol | ||
| − | == Reaction | + | == Reaction(s) known to consume the compound == |
| − | * | + | * [[RXN-7984]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-7979]] | |
| − | * | + | * [[RXN-13193]] |
| − | + | * [[ANXANor]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | * [[RXN-13185]] | |
| − | * [[ | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | * | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=448438 448438] |
| − | {{#set: | + | * HMDB : HMDB03101 |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=35288 35288] |
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C08614 C08614] |
| − | {{#set: | + | {{#set: smiles=CC(=CC=CC=C(C=CC=C(C)C=CC12(C(C)(C)CC(O)CC(O1)(C)2))C)C=CC=C(C)C=CC34(C(C)(C)CC(O)CC(O3)(C)4)}} |
| + | {{#set: common name=violaxanthin}} | ||
| + | {{#set: inchi key=InChIKey=SZCBXWMUOPQSOX-WVJDLNGLSA-N}} | ||
| + | {{#set: molecular weight=600.88 }} | ||
| + | {{#set: common name=5,6,5',6'-diepoxy-5,6,5',6'-tetrahydro-β,β-carotene-3,3'-diol}} | ||
| + | {{#set: consumed by=RXN-7984}} | ||
| + | {{#set: produced by=RXN-7979|RXN-13193|ANXANor}} | ||
| + | {{#set: reversible reaction associated=RXN-13185}} | ||
Latest revision as of 19:18, 21 March 2018
Contents
Metabolite CPD1F-133
- smiles:
- CC(=CC=CC=C(C=CC=C(C)C=CC12(C(C)(C)CC(O)CC(O1)(C)2))C)C=CC=C(C)C=CC34(C(C)(C)CC(O)CC(O3)(C)4)
- common name:
- violaxanthin
- inchi key:
- InChIKey=SZCBXWMUOPQSOX-WVJDLNGLSA-N
- molecular weight:
- 600.88
- Synonym(s):
- 5,6,5',6'-diepoxy-5,6,5',6'-tetrahydro-β,β-carotene-3,3'-diol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
