Difference between revisions of "Lipid-hydroxy-fatty-acids"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLUTARYL-COA GLUTARYL-COA] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CCCC(=O)[O-])=O)COP(=O)...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Lipid-hydroxy-fatty-acids Lipid-hydroxy-fatty-acids] == * common name: ** a hydroxy-fatty-acyl-...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLUTARYL-COA GLUTARYL-COA] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Lipid-hydroxy-fatty-acids Lipid-hydroxy-fatty-acids] ==
* smiles:
+
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CCCC(=O)[O-])=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
* inchi key:
+
** InChIKey=SYKWLIJQEHRDNH-CKRMAKSASA-I
+
 
* common name:
 
* common name:
** glutaryl-CoA
+
** a hydroxy-fatty-acyl-[lipid]
* molecular weight:
+
** 876.595   
+
 
* Synonym(s):
 
* Synonym(s):
** glutaryl-coenzyme A
 
** 4-carboxybutanoyl-CoA
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2-KETO-ADIPATE-DEHYDROG-RXN]]
+
* [[1.11.1.12-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[RXN-8032]]
 
 
== External links  ==
 
== External links  ==
* LIGAND-CPD:
+
{{#set: common name=a hydroxy-fatty-acyl-[lipid]}}
** [http://www.genome.jp/dbget-bin/www_bget?C00527 C00527]
+
{{#set: produced by=1.11.1.12-RXN}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57378 57378]
+
* METABOLIGHTS : MTBLC57378
+
* PUBCHEM:
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266604 45266604]
+
* HMDB : HMDB01339
+
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CCCC(=O)[O-])=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: inchi key=InChIKey=SYKWLIJQEHRDNH-CKRMAKSASA-I}}
+
{{#set: common name=glutaryl-CoA}}
+
{{#set: molecular weight=876.595    }}
+
{{#set: common name=glutaryl-coenzyme A|4-carboxybutanoyl-CoA}}
+
{{#set: produced by=2-KETO-ADIPATE-DEHYDROG-RXN}}
+
{{#set: consumed or produced by=RXN-8032}}
+

Latest revision as of 20:18, 21 March 2018

Metabolite Lipid-hydroxy-fatty-acids

  • common name:
    • a hydroxy-fatty-acyl-[lipid]
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a hydroxy-fatty-acyl-[lipid" cannot be used as a page name in this wiki.