Difference between revisions of "PWY-7339"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1091 CPD-1091] == * smiles: ** C(O)(C([O-])=O)NC(N)=O * inchi key: ** InChIKey=NWZYYCVIOKVT...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7339 PWY-7339] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-47...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1091 CPD-1091] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7339 PWY-7339] ==
* smiles:
+
* taxonomic range:
** C(O)(C([O-])=O)NC(N)=O
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
* inchi key:
+
** InChIKey=NWZYYCVIOKVTII-SFOWXEAESA-M
+
 
* common name:
 
* common name:
** S-ureidoglycolate
+
** 10-trans-heptadecenoyl-CoA degradation (MFE-dependent, yeast)
* molecular weight:
+
** 133.083   
+
 
* Synonym(s):
 
* Synonym(s):
** (-)-ureidoglycolate
 
** ureidoglycolate
 
** S-(-)-ureidoglycolate
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''1''' reactions found over '''6''' reactions in the full pathway
* [[ALLANTOICASE-RXN]]
+
* [[RXN-14793]]
== Reaction(s) of unknown directionality ==
+
** 5 associated gene(s):
 +
*** [[Tiso_gene_10116]]
 +
*** [[Tiso_gene_3856]]
 +
*** [[Tiso_gene_15327]]
 +
*** [[Tiso_gene_3855]]
 +
*** [[Tiso_gene_17451]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[annotation-in-silico_annotation]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-14780 RXN-14780]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-14781 RXN-14781]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-14791 RXN-14791]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-14792 RXN-14792]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-14794 RXN-14794]
 
== External links  ==
 
== External links  ==
* CAS : 2017665
+
{{#set: taxonomic range=TAX-4751}}
* PUBCHEM:
+
{{#set: common name=10-trans-heptadecenoyl-CoA degradation (MFE-dependent, yeast)}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=23615273 23615273]
+
{{#set: reaction found=1}}
* HMDB : HMDB01005
+
{{#set: total reaction=6}}
* LIGAND-CPD:
+
{{#set: completion rate=17.0}}
** [http://www.genome.jp/dbget-bin/www_bget?C00603 C00603]
+
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.19951218.html 19951218]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57296 57296]
+
* BIGG : urdglyc
+
{{#set: smiles=C(O)(C([O-])=O)NC(N)=O}}
+
{{#set: inchi key=InChIKey=NWZYYCVIOKVTII-SFOWXEAESA-M}}
+
{{#set: common name=S-ureidoglycolate}}
+
{{#set: molecular weight=133.083    }}
+
{{#set: common name=(-)-ureidoglycolate|ureidoglycolate|S-(-)-ureidoglycolate}}
+
{{#set: produced by=ALLANTOICASE-RXN}}
+

Latest revision as of 19:18, 21 March 2018

Pathway PWY-7339

  • taxonomic range:
  • common name:
    • 10-trans-heptadecenoyl-CoA degradation (MFE-dependent, yeast)
  • Synonym(s):

Reaction(s) found

1 reactions found over 6 reactions in the full pathway

Reaction(s) not found

External links