Difference between revisions of "CPD-5721"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6333 PWY-6333] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-3...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5721 CPD-5721] == * smiles: ** C1(N=C2(N=C(N)N=C([S-])C(N=1)2)) * common name: ** thioguani...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Pathway]]
+
[[Category:Metabolite]]
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6333 PWY-6333] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5721 CPD-5721] ==
* taxonomic range:
+
* smiles:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
+
** C1(N=C2(N=C(N)N=C([S-])C(N=1)2))
 
* common name:
 
* common name:
** acetaldehyde biosynthesis I
+
** thioguanine
 +
* inchi key:
 +
** InChIKey=UHLHHUAQNRJGFS-UHFFFAOYSA-M
 +
* molecular weight:
 +
** 166.18   
 
* Synonym(s):
 
* Synonym(s):
** anoxic acetaldehyde biosynthesis
+
** 6-thioguanine
** flooding related acetaldehyde biosynthesis
+
** 6-mercaptoguanine
  
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
'''1''' reactions found over '''1''' reactions in the full pathway
+
== Reaction(s) known to produce the compound ==
* [[ALCOHOL-DEHYDROG-RXN]]
+
== Reaction(s) of unknown directionality ==
** 6 associated gene(s):
+
* [[TGUAt]]
*** [[Tiso_gene_7649]]
+
*** [[Tiso_gene_18459]]
+
*** [[Tiso_gene_6562]]
+
*** [[Tiso_gene_6563]]
+
*** [[Tiso_gene_5424]]
+
*** [[Tiso_gene_5425]]
+
** 2 reconstruction source(s) associated:
+
*** [[annotation-in-silico_annotation]]
+
*** [[orthology-synechocystis]]
+
== Reaction(s) not found ==
+
 
== External links  ==
 
== External links  ==
{{#set: taxonomic range=TAX-33090}}
+
* DRUGBANK : DB00352
{{#set: common name=acetaldehyde biosynthesis I}}
+
* LIGAND-CPD:
{{#set: common name=anoxic acetaldehyde biosynthesis|flooding related acetaldehyde biosynthesis}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C07648 C07648]
{{#set: reaction found=1}}
+
* HMDB : HMDB14496
{{#set: total reaction=1}}
+
* CHEBI:
{{#set: completion rate=100.0}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=9555 9555]
 +
* PUBCHEM:
 +
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203152 25203152]
 +
{{#set: smiles=C1(N=C2(N=C(N)N=C([S-])C(N=1)2))}}
 +
{{#set: common name=thioguanine}}
 +
{{#set: inchi key=InChIKey=UHLHHUAQNRJGFS-UHFFFAOYSA-M}}
 +
{{#set: molecular weight=166.18    }}
 +
{{#set: common name=6-thioguanine|6-mercaptoguanine}}
 +
{{#set: reversible reaction associated=TGUAt}}

Latest revision as of 19:19, 21 March 2018

Metabolite CPD-5721

  • smiles:
    • C1(N=C2(N=C(N)N=C([S-])C(N=1)2))
  • common name:
    • thioguanine
  • inchi key:
    • InChIKey=UHLHHUAQNRJGFS-UHFFFAOYSA-M
  • molecular weight:
    • 166.18
  • Synonym(s):
    • 6-thioguanine
    • 6-mercaptoguanine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C1(N=C2(N=C(N)N=C([S-])C(N=1)2))" cannot be used as a page name in this wiki.