Difference between revisions of "CPD-5721"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ABor ABor] == * direction: ** LEFT-TO-RIGHT * common name: ** 4-Aminobutyraldehyde:NAD+ oxidoreduct...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5721 CPD-5721] == * smiles: ** C1(N=C2(N=C(N)N=C([S-])C(N=1)2)) * common name: ** thioguani...")
 
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ABor ABor] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5721 CPD-5721] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C1(N=C2(N=C(N)N=C([S-])C(N=1)2))
 
* common name:
 
* common name:
−
** 4-Aminobutyraldehyde:NAD+ oxidoreductase
+
** thioguanine
 +
* inchi key:
 +
** InChIKey=UHLHHUAQNRJGFS-UHFFFAOYSA-M
 +
* molecular weight:
 +
** 166.18   
 
* Synonym(s):
 
* Synonym(s):
 +
** 6-thioguanine
 +
** 6-mercaptoguanine
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1.0 [[4-AMINO-BUTYRALDEHYDE]][m] '''+''' 1.0 [[NADP]][m] '''+''' 1.0 [[WATER]][m] '''=>''' 1.0 [[NADPH]][m] '''+''' 2.0 [[PROTON]][m] '''+''' 1.0 [[4-AMINO-BUTYRATE]][m]
+
== Reaction(s) of unknown directionality ==
−
* With common name(s):
+
* [[TGUAt]]
−
** 1.0 4-aminobutanal[m] '''+''' 1.0 NADP+[m] '''+''' 1.0 H2O[m] '''=>''' 1.0 NADPH[m] '''+''' 2.0 H+[m] '''+''' 1.0 4-aminobutanoate[m]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* Gene: [[Tiso_gene_3513]]
+
−
** Source: [[orthology-creinhardtii]]
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* Category: [[orthology]]
+
−
** Source: [[orthology-creinhardtii]]
+
−
*** Tool: [[pantograph]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* DRUGBANK : DB00352
−
{{#set: common name=4-Aminobutyraldehyde:NAD+ oxidoreductase}}
+
* LIGAND-CPD:
−
{{#set: gene associated=Tiso_gene_3513}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C07648 C07648]
−
{{#set: in pathway=}}
+
* HMDB : HMDB14496
−
{{#set: reconstruction category=orthology}}
+
* CHEBI:
−
{{#set: reconstruction source=orthology-creinhardtii}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=9555 9555]
−
{{#set: reconstruction tool=pantograph}}
+
* PUBCHEM:
 +
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203152 25203152]
 +
{{#set: smiles=C1(N=C2(N=C(N)N=C([S-])C(N=1)2))}}
 +
{{#set: common name=thioguanine}}
 +
{{#set: inchi key=InChIKey=UHLHHUAQNRJGFS-UHFFFAOYSA-M}}
 +
{{#set: molecular weight=166.18    }}
 +
{{#set: common name=6-thioguanine|6-mercaptoguanine}}
 +
{{#set: reversible reaction associated=TGUAt}}

Latest revision as of 20:19, 21 March 2018

Metabolite CPD-5721

  • smiles:
    • C1(N=C2(N=C(N)N=C([S-])C(N=1)2))
  • common name:
    • thioguanine
  • inchi key:
    • InChIKey=UHLHHUAQNRJGFS-UHFFFAOYSA-M
  • molecular weight:
    • 166.18
  • Synonym(s):
    • 6-thioguanine
    • 6-mercaptoguanine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C1(N=C2(N=C(N)N=C([S-])C(N=1)2))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-5721&oldid=40826"