Difference between revisions of "Tiso gene 7260"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-548 CPD-548] == * smiles: ** C(NC(=O)C(CSC=O)NC(=O)CCC([N+])C(=O)[O-])C(=O)[O-] * inchi key...") |
(Created page with "Category:Gene == Gene Tiso_gene_7260 == * Synonym(s): == Reactions associated == * Reaction: UBIQUITIN-THIOLESTERASE-RXN ** Source: orthology-esiliculosus == Path...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_7260 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[UBIQUITIN-THIOLESTERASE-RXN]] |
− | + | ** Source: [[orthology-esiliculosus]] | |
− | * [[ | + | == Pathways associated == |
− | == | + | |
− | + | ||
== External links == | == External links == | ||
− | + | {{#set: reaction associated=UBIQUITIN-THIOLESTERASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + |
Latest revision as of 20:19, 21 March 2018
Gene Tiso_gene_7260
- Synonym(s):
Reactions associated
- Reaction: UBIQUITIN-THIOLESTERASE-RXN
- Source: orthology-esiliculosus