Difference between revisions of "CPD-15692"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_9846 == * Synonym(s): == Reactions associated == * PROTEIN-KINASE-RXN ** pantograph-esiliculosus == Pathways associated == ==...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15692 CPD-15692] == * smiles: ** CCCCCCC=CCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15692 CPD-15692] == |
+ | * smiles: | ||
+ | ** CCCCCCC=CCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] | ||
+ | * common name: | ||
+ | ** 3-trans-decenoyl-CoA | ||
+ | * inchi key: | ||
+ | ** InChIKey=CQGVNMQHZQJNII-ZJZQAHHTSA-J | ||
+ | * molecular weight: | ||
+ | ** 915.738 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 3E-decenoyl-CoA | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | * [[RXN-14803]] | |
− | == | + | == Reaction(s) of unknown directionality == |
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657610 90657610] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=84793 84793] | ||
+ | {{#set: smiles=CCCCCCC=CCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} | ||
+ | {{#set: common name=3-trans-decenoyl-CoA}} | ||
+ | {{#set: inchi key=InChIKey=CQGVNMQHZQJNII-ZJZQAHHTSA-J}} | ||
+ | {{#set: molecular weight=915.738 }} | ||
+ | {{#set: common name=3E-decenoyl-CoA}} | ||
+ | {{#set: produced by=RXN-14803}} |
Latest revision as of 19:19, 21 March 2018
Contents
Metabolite CPD-15692
- smiles:
- CCCCCCC=CCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- common name:
- 3-trans-decenoyl-CoA
- inchi key:
- InChIKey=CQGVNMQHZQJNII-ZJZQAHHTSA-J
- molecular weight:
- 915.738
- Synonym(s):
- 3E-decenoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCCC=CCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.